compound 22 [PMID: 17276684]
SMILES | Cc1cc2[nH]c3c(c2cc1OCc1ccccc1)CCNC3=O |
InChIKey | DYTMNPUOZGPWQA-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 2 |
Hydrogen bond donors | 2 |
Rotatable bonds | 3 |
Molecular weight (Da) | 306.1 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pKi | 8.44 | 8.44 | 8.44 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pIC50 | 6.78 | 6.78 | 6.78 | Guide to Pharmacology |
mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pIC50 | 6.78 | 6.78 | 6.78 | ChEMBL |