CHEMBL1817756
SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@H](Cc2ccco2)NC(=O)[C@@H](N)CSSC[C@@H](C(=O)N2CCC[C@H]2C(=O)N[C@@H](CCCNC(C)C)C(=O)NCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC1=O |
InChIKey | KGNKNMVBIGDPEV-GHDRINTISA-N |
Chemical properties
Hydrogen bond acceptors | None |
Hydrogen bond donors | None |
Rotatable bonds | None |
Molecular weight (Da) |
Drug properties
Molecular type | Protein |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
OT | OXYR | Human | Vasopressin and oxytocin | A | pEC50 | 6.58 | 6.58 | 6.59 | ChEMBL |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pEC50 | 8.58 | 8.59 | 8.59 | ChEMBL |
V1B | V1BR | Human | Vasopressin and oxytocin | A | pEC50 | 6.24 | 6.24 | 6.24 | ChEMBL |
V2 | V2R | Human | Vasopressin and oxytocin | A | pEC50 | 6.02 | 6.02 | 6.02 | ChEMBL |
V1A | V1AR | Rat | Vasopressin and oxytocin | A | pEC50 | 9.21 | 9.21 | 9.21 | ChEMBL |