ADX-47273
SMILES | Fc1ccc(cc1)C(=O)N1CCC[C@@H](C1)c1onc(n1)c1ccc(cc1)F |
InChIKey | VXQCCZHCFBHTTD-HNNXBMFYSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 0 |
Rotatable bonds | 3 |
Molecular weight (Da) | 369.1 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pKi | 5.44 | 5.44 | 5.44 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pEC50 | 6.8 | 6.8 | 6.8 | Guide to Pharmacology |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pIC50 | 6.5 | 6.5 | 6.5 | Guide to Pharmacology |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pEC50 | 7.26 | 7.26 | 7.26 | Guide to Pharmacology |
mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pEC50 | 6.7 | 6.73 | 6.8 | ChEMBL |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pEC50 | 6.77 | 7.01 | 7.26 | ChEMBL |