VU-29
SMILES | O=C(c1ccc(cc1)N(=O)=O)Nc1cc(nn1c1ccccc1)c1ccccc1 |
InChIKey | KIALCSMRIHRFPL-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 5 |
Hydrogen bond donors | 1 |
Rotatable bonds | 5 |
Molecular weight (Da) | 384.1 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Ligand site mutations | mGlu5 |
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pKi | 6.6 | 6.6 | 6.6 | ChEMBL |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pKi | 6.61 | 6.61 | 6.61 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pEC50 | 7.97 | 7.97 | 7.97 | ChEMBL |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pEC50 | 8.05 | 8.05 | 8.05 | Guide to Pharmacology |