(S)-4CPG
SMILES | N[C@@H](c1ccc(cc1)C(=O)O)C(=O)O |
InChIKey | VTMJKPGFERYGJF-ZETCQYMHSA-N |
Chemical properties
Hydrogen bond acceptors | 3 |
Hydrogen bond donors | 3 |
Rotatable bonds | 3 |
Molecular weight (Da) | 195.1 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pKi | 4.08 | 4.08 | 4.08 | ChEMBL |
mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pKi | 5.43 | 5.43 | 5.43 | ChEMBL |
mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pKi | 5.4 | 5.4 | 5.4 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pIC50 | 4.19 | 4.48 | 5.0 | ChEMBL |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pIC50 | 4.6 | 4.6 | 4.6 | Guide to Pharmacology |