norfluoxetine
| SMILES | NCCC(c1ccccc1)Oc1ccc(cc1)C(F)(F)F |
| InChIKey | WIQRCHMSJFFONW-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 2 |
| Hydrogen bond donors | 1 |
| Rotatable bonds | 5 |
| Molecular weight (Da) | 295.1 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pKi | 6.71 | 6.71 | 6.71 | ChEMBL |
| mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pKi | 8.3 | 8.3 | 8.3 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pIC50 | 8.52 | 8.52 | 8.52 | Guide to Pharmacology |
| mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pIC50 | 8.33 | 8.33 | 8.33 | Guide to Pharmacology |
| mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pIC50 | 8.52 | 8.52 | 8.52 | ChEMBL |
| mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pIC50 | 6.36 | 6.36 | 6.36 | ChEMBL |
| mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pIC50 | 5.88 | 5.88 | 5.88 | ChEMBL |
| mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pIC50 | 8.3 | 8.45 | 8.52 | ChEMBL |