raclopride
| SMILES | CCN1CCC[C@H]1CNC(=O)c1c(O)c(Cl)cc(c1OC)Cl |
| InChIKey | WAOQONBSWFLFPE-VIFPVBQESA-N |
Chemical properties
| Hydrogen bond acceptors | 4 |
| Hydrogen bond donors | 2 |
| Rotatable bonds | 5 |
| Molecular weight (Da) | 346.1 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | Yes |
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pKi | 6.44 | 7.33 | 8.21 | Guide to Pharmacology |
| mGlu2 | GRM2 | Rat | Metabotropic glutamate | C | pKi | 8.27 | 8.27 | 8.27 | Guide to Pharmacology |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu3 | GRM3 | Human | Metabotropic glutamate | C | pIC50 | 6.57 | 6.57 | 6.57 | ChEMBL |
| mGlu2 | GRM2 | Rat | Metabotropic glutamate | C | pIC50 | 8.52 | 8.61 | 8.7 | ChEMBL |
| mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pIC50 | 6.53 | 6.97 | 7.85 | ChEMBL |
| mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pIC50 | 7.85 | 7.85 | 7.85 | Guide to Pharmacology |
| mGlu3 | GRM3 | Human | Metabotropic glutamate | C | pIC50 | 6.6 | 6.6 | 6.6 | Guide to Pharmacology |
| mGlu3 | GRM3 | Rat | Metabotropic glutamate | C | pIC50 | 8.0 | 8.0 | 8.0 | Guide to Pharmacology |
| mGlu2 | GRM2 | Rat | Metabotropic glutamate | C | pIC50 | 6.53 | 7.62 | 8.7 | Guide to Pharmacology |