timolol
SMILES | O[C@H](COc1nsnc1N1CCOCC1)CNC(C)(C)C |
InChIKey | BLJRIMJGRPQVNF-JTQLQIEISA-N |
Chemical properties
Hydrogen bond acceptors | 8 |
Hydrogen bond donors | 2 |
Rotatable bonds | 6 |
Molecular weight (Da) | 316.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | Yes |
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
β1 | ADRB1 | Rat | Adrenoceptors | A | pKi | 6.2 | 7.62 | 8.5 | ChEMBL |
β1 | B0FL73 | Guinea pig | Adrenoceptors | A | pKd | 9.44 | 9.44 | 9.44 | ChEMBL |
β2 | ADRB2 | Guinea pig | Adrenoceptors | A | pKd | 9.62 | 9.67 | 9.78 | ChEMBL |
β1 | ADRB1 | Human | Adrenoceptors | A | pKi | 8.27 | 8.54 | 8.82 | ChEMBL |
β2 | ADRB2 | Human | Adrenoceptors | A | pKi | 9.68 | 9.69 | 9.7 | ChEMBL |
β1 | ADRB1 | Human | Adrenoceptors | A | pKi | 8.05 | 8.05 | 8.05 | Drug Central |
5-HT1A | 5HT1A | Human | 5-Hydroxytryptamine | A | pKi | 8.24 | 8.24 | 8.24 | Drug Central |
5-HT2A | 5HT2A | Human | 5-Hydroxytryptamine | A | pKi | 5.0 | 5.0 | 5.0 | PDSP Ki database |
β1 | ADRB1 | Human | Adrenoceptors | A | pKi | 8.3 | 8.65 | 9.0 | Guide to Pharmacology |
β2 | ADRB2 | Human | Adrenoceptors | A | pKi | 8.01 | 8.01 | 8.01 | Drug Central |
β2 | ADRB2 | Human | Adrenoceptors | A | pKi | 9.7 | 9.7 | 9.7 | Guide to Pharmacology |
β3 | ADRB3 | Human | Adrenoceptors | A | pKi | 8.19 | 8.19 | 8.19 | Drug Central |
β3 | ADRB3 | Human | Adrenoceptors | A | pKi | 6.47 | 6.47 | 6.47 | ChEMBL |
5-HT1A | 5HT1A | Rat | 5-Hydroxytryptamine | A | pKi | 8.21 | 8.21 | 8.21 | Drug Central |
5-HT1A | 5HT1A | Rat | 5-Hydroxytryptamine | A | pKi | 5.81 | 6.01 | 6.21 | ChEMBL |
β2 | ADRB2 | Guinea pig | Adrenoceptors | A | pKd | 8.01 | 8.01 | 8.01 | Drug Central |
β1 | B0FL73 | Guinea pig | Adrenoceptors | A | pKd | 8.03 | 8.03 | 8.03 | Drug Central |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
M1 | ACM1 | Rat | Acetylcholine (muscarinic) | A | Potency | 5.3 | 5.3 | 5.3 | ChEMBL |
β1 | ADRB1 | Human | Adrenoceptors | A | pIC50 | 8.59 | 8.59 | 8.59 | ChEMBL |
β2 | ADRB2 | Human | Adrenoceptors | A | pIC50 | 9.54 | 9.54 | 9.54 | ChEMBL |
β3 | ADRB3 | Human | Adrenoceptors | A | pIC50 | 6.34 | 6.34 | 6.34 | ChEMBL |
5-HT1A | 5HT1A | Rat | 5-Hydroxytryptamine | A | pIC50 | 5.57 | 5.57 | 5.57 | ChEMBL |