butoxamine
SMILES | COc1ccc(cc1C(C(NC(C)(C)C)C)O)OC |
InChIKey | TWUSDDMONZULSC-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 2 |
Rotatable bonds | 5 |
Molecular weight (Da) | 267.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
β2 | ADRB2 | Rat | Adrenoceptors | A | pKi | 6.33 | 6.42 | 6.51 | Guide to Pharmacology |
β1 | B0FL73 | Guinea pig | Adrenoceptors | A | pKd | 4.35 | 4.35 | 4.35 | ChEMBL |
β2 | ADRB2 | Guinea pig | Adrenoceptors | A | pKd | 6.89 | 6.89 | 6.89 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
β2 | ADRB2 | Human | Adrenoceptors | A | pKB | 6.2 | 6.35 | 6.5 | Guide to Pharmacology |
β2 | ADRB2 | Rat | Adrenoceptors | A | pKB | 6.45 | 6.45 | 6.45 | Guide to Pharmacology |