ergotamine
| SMILES | O=C([C@H]1CN(C)[C@H]2C(=C1)c1cccc3c1c(C2)c[nH]3)N[C@]1(C)O[C@@]2(N(C1=O)[C@@H](Cc1ccccc1)C(=O)N1[C@H]2CCC1)O |
| InChIKey | XCGSFFUVFURLIX-VFGNJEKYSA-N |
Chemical properties
| Hydrogen bond acceptors | 6 |
| Hydrogen bond donors | 3 |
| Rotatable bonds | 4 |
| Molecular weight (Da) | 581.3 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | Yes |
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| 5-HT1D | 5HT1D | Human | 5-Hydroxytryptamine | A | pKi | 9.1 | 9.1 | 9.1 | Guide to Pharmacology |
| 5-HT1E | 5HT1E | Human | 5-Hydroxytryptamine | A | pKi | 6.2 | 6.25 | 6.3 | Guide to Pharmacology |
| 5-HT1F | 5HT1F | Human | 5-Hydroxytryptamine | A | pKi | 6.8 | 6.8 | 6.8 | Guide to Pharmacology |
| 5-HT2A | 5HT2A | Human | 5-Hydroxytryptamine | A | pKi | 9.0 | 9.0 | 9.0 | Guide to Pharmacology |
| 5-HT2B | 5HT2B | Human | 5-Hydroxytryptamine | A | pKi | 8.5 | 8.7 | 8.9 | Guide to Pharmacology |
| 5-HT5A | 5HT5A | Human | 5-Hydroxytryptamine | A | pKi | 8.0 | 8.35 | 8.7 | Guide to Pharmacology |
| 5-HT6 | 5HT6R | Human | 5-Hydroxytryptamine | A | pKi | 8.0 | 8.3 | 8.6 | Guide to Pharmacology |
| 5-HT6 | 5HT6R | Rat | 5-Hydroxytryptamine | A | pKi | 7.0 | 7.8 | 8.6 | Guide to Pharmacology |
| 5-HT2A | 5HT2A | Rat | 5-Hydroxytryptamine | A | pKi | 8.0 | 8.0 | 8.0 | Guide to Pharmacology |
| 5-HT5A | 5HT5A | Rat | 5-Hydroxytryptamine | A | pKi | 8.2 | 8.2 | 8.2 | Guide to Pharmacology |
| 5-HT7 | 5HT7R | Mouse | 5-Hydroxytryptamine | A | pKi | 7.3 | 7.3 | 7.3 | Guide to Pharmacology |
| 5-HT5A | 5HT5A | Mouse | 5-Hydroxytryptamine | A | pKi | 7.4 | 7.9 | 8.4 | Guide to Pharmacology |
| 5-HT5A | 5HT5A | Human | 5-Hydroxytryptamine | A | pKi | 7.4 | 7.7 | 7.85 | ChEMBL |
| 5-HT1B | 5HT1B | Rat | 5-Hydroxytryptamine | A | pKi | 10.04 | 10.04 | 10.04 | ChEMBL |
| α1B | ADA1B | Rat | Adrenoceptors | A | pKi | 8.34 | 8.34 | 8.34 | ChEMBL |
| 5-HT1B | 5HT1B | Human | 5-Hydroxytryptamine | A | pKi | 8.51 | 8.57 | 8.68 | ChEMBL |
| 5-HT4 | 5HT4R | Guinea pig | 5-Hydroxytryptamine | A | pKi | 6.58 | 6.58 | 6.58 | ChEMBL |
| 5-HT1D | 5HT1D | Human | 5-Hydroxytryptamine | A | pKi | 8.22 | 8.59 | 9.1 | ChEMBL |
| α1A | ADA1A | Rat | Adrenoceptors | A | pKi | 8.49 | 8.49 | 8.49 | ChEMBL |
| α1D | ADA1D | Human | Adrenoceptors | A | pKi | 7.62 | 7.62 | 7.62 | ChEMBL |
| α2B | ADA2B | Human | Adrenoceptors | A | pKi | 8.76 | 8.76 | 8.76 | ChEMBL |
| α2C | ADA2C | Human | Adrenoceptors | A | pKi | 8.74 | 8.74 | 8.74 | ChEMBL |
| β1 | ADRB1 | Human | Adrenoceptors | A | pKi | 5.62 | 5.62 | 5.62 | ChEMBL |
| 5-HT1A | 5HT1A | Rat | 5-Hydroxytryptamine | A | pKi | 9.35 | 9.35 | 9.35 | ChEMBL |
| α2A | ADA2A | Human | Adrenoceptors | A | pKi | 9.1 | 9.1 | 9.1 | ChEMBL |
| D1 | DRD1 | Human | Dopamine | A | pKi | 6.06 | 6.06 | 6.06 | ChEMBL |
| 5-HT6 | 5HT6R | Human | 5-Hydroxytryptamine | A | pKi | 9.02 | 9.02 | 9.02 | ChEMBL |
| 5-HT2B | 5HT2B | Human | 5-Hydroxytryptamine | A | pKi | 8.66 | 8.66 | 8.66 | ChEMBL |
| 5-HT2C | 5HT2C | Human | 5-Hydroxytryptamine | A | pKi | 7.54 | 7.54 | 7.54 | ChEMBL |
| β2 | ADRB2 | Human | Adrenoceptors | A | pKi | 5.72 | 5.72 | 5.72 | ChEMBL |
| D3 | DRD3 | Human | Dopamine | A | pKi | 8.83 | 8.83 | 8.83 | ChEMBL |
| 5-HT2A | 5HT2A | Human | 5-Hydroxytryptamine | A | pKi | 8.73 | 8.73 | 8.73 | ChEMBL |
| D2 | DRD2 | Human | Dopamine | A | pKi | 8.84 | 8.84 | 8.84 | ChEMBL |
| 5-HT2C | 5HT2C | Human | 5-Hydroxytryptamine | A | pKi | 8.7 | 8.7 | 8.7 | Guide to Pharmacology |
| 5-HT2C | 5HT2C | Rat | 5-Hydroxytryptamine | A | pKi | 7.9 | 7.9 | 7.9 | Guide to Pharmacology |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| 5-HT1F | 5HT1F | Rat | 5-Hydroxytryptamine | A | pIC50 | 7.3 | 7.3 | 7.3 | Guide to Pharmacology |
| CCK2 | GASR | Mouse | Cholecystokinin | A | pIC50 | 4.77 | 4.77 | 4.77 | ChEMBL |
| 5-HT1B | 5HT1B | Rat | 5-Hydroxytryptamine | A | pIC50 | 9.7 | 9.7 | 9.7 | ChEMBL |
| α1B | ADA1B | Rat | Adrenoceptors | A | pIC50 | 8.09 | 8.09 | 8.09 | ChEMBL |
| 5-HT4 | 5HT4R | Guinea pig | 5-Hydroxytryptamine | A | pIC50 | 5.8 | 5.8 | 5.8 | ChEMBL |
| α1A | ADA1A | Rat | Adrenoceptors | A | pIC50 | 8.09 | 8.09 | 8.09 | ChEMBL |
| α1D | ADA1D | Human | Adrenoceptors | A | pIC50 | 7.31 | 7.31 | 7.31 | ChEMBL |
| α2B | ADA2B | Human | Adrenoceptors | A | pIC50 | 8.41 | 8.41 | 8.41 | ChEMBL |
| α2C | ADA2C | Human | Adrenoceptors | A | pIC50 | 7.92 | 7.92 | 7.92 | ChEMBL |
| β1 | ADRB1 | Human | Adrenoceptors | A | pIC50 | 5.38 | 5.38 | 5.38 | ChEMBL |
| 5-HT1A | 5HT1A | Rat | 5-Hydroxytryptamine | A | pIC50 | 9.11 | 9.11 | 9.11 | ChEMBL |
| α2A | ADA2A | Human | Adrenoceptors | A | pIC50 | 8.67 | 8.67 | 8.67 | ChEMBL |
| D1 | DRD1 | Human | Dopamine | A | pIC50 | 5.76 | 5.76 | 5.76 | ChEMBL |
| 5-HT6 | 5HT6R | Human | 5-Hydroxytryptamine | A | pIC50 | 8.69 | 8.69 | 8.69 | ChEMBL |
| 5-HT2B | 5HT2B | Human | 5-Hydroxytryptamine | A | pIC50 | 8.46 | 8.46 | 8.46 | ChEMBL |
| 5-HT2C | 5HT2C | Human | 5-Hydroxytryptamine | A | pIC50 | 7.25 | 7.25 | 7.25 | ChEMBL |
| β2 | ADRB2 | Human | Adrenoceptors | A | pIC50 | 5.56 | 5.56 | 5.56 | ChEMBL |
| D3 | DRD3 | Human | Dopamine | A | pIC50 | 8.37 | 8.37 | 8.37 | ChEMBL |
| 5-HT2A | 5HT2A | Human | 5-Hydroxytryptamine | A | pIC50 | 8.19 | 8.19 | 8.19 | ChEMBL |
| D2 | DRD2 | Human | Dopamine | A | pIC50 | 8.37 | 8.37 | 8.37 | ChEMBL |
| CCK1 | CCKAR | Mouse | Cholecystokinin | A | pIC50 | 4.47 | 4.47 | 4.47 | ChEMBL |