AR-M1000390
SMILES | CCN(C(=O)c1ccc(cc1)C(=C1CCNCC1)c1ccccc1)CC |
InChIKey | SMUGAZNLKPFBSB-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 2 |
Hydrogen bond donors | 1 |
Rotatable bonds | 5 |
Molecular weight (Da) | 348.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
δ | OPRD | Human | Opioid | A | pKi | 6.97 | 6.97 | 6.97 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
κ | OPRK | Human | Opioid | A | pIC50 | 5.13 | 5.13 | 5.13 | Guide to Pharmacology |
μ | OPRM | Human | Opioid | A | pIC50 | 5.42 | 5.42 | 5.42 | Guide to Pharmacology |
δ | OPRD | Human | Opioid | A | pEC50 | 8.14 | 8.14 | 8.14 | ChEMBL |
δ | OPRD | Human | Opioid | A | pIC50 | 9.06 | 9.06 | 9.06 | ChEMBL |
δ | OPRD | Human | Opioid | A | pIC50 | 9.05 | 9.05 | 9.05 | Guide to Pharmacology |
κ | OPRK | Human | Opioid | A | pIC50 | 5.13 | 5.13 | 5.13 | ChEMBL |
μ | OPRM | Human | Opioid | A | pIC50 | 5.42 | 5.42 | 5.42 | ChEMBL |