Ligand source activities (1 row/activity)
Ligands | Receptor | Assay information | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name |
GPCRdb ID | #Vendors | Reference ligand |
Fold selectivity (Potency) |
# tested GPCRs (Potency) |
Species | p-value (-log) |
Type | Activity Relation |
Activity Value |
Assay Type | Assay Description | Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI |
1079 | 888 | 39 | None | 63 | 4 | Rat | 6.7 | pEC50 | None | 6.7 | Functional | Guide to Pharmacology | 292 | 3 | 2 | 2 | 4.5 | OCC(Cc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)(C)C | 11641424 | ||
1079 | 888 | 39 | None | 63 | 4 | Rat | 6.7 | pEC50 | None | 6.7 | Functional | Guide to Pharmacology | 292 | 3 | 2 | 2 | 4.5 | OCC(Cc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)(C)C | 15126507 | ||
5024764 | 888 | 39 | None | 63 | 4 | Rat | 6.7 | pEC50 | None | 6.7 | Functional | Guide to Pharmacology | 292 | 3 | 2 | 2 | 4.5 | OCC(Cc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)(C)C | 11641424 | ||
5024764 | 888 | 39 | None | 63 | 4 | Rat | 6.7 | pEC50 | None | 6.7 | Functional | Guide to Pharmacology | 292 | 3 | 2 | 2 | 4.5 | OCC(Cc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)(C)C | 15126507 | ||
CHEMBL1256697 | 888 | 39 | None | 63 | 4 | Rat | 6.7 | pEC50 | None | 6.7 | Functional | Guide to Pharmacology | 292 | 3 | 2 | 2 | 4.5 | OCC(Cc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)(C)C | 11641424 | ||
CHEMBL1256697 | 888 | 39 | None | 63 | 4 | Rat | 6.7 | pEC50 | None | 6.7 | Functional | Guide to Pharmacology | 292 | 3 | 2 | 2 | 4.5 | OCC(Cc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)(C)C | 15126507 | ||
2997 | 215972 | 0 | None | - | 1 | Human | 8.1 | pIC50 | = | 8.1 | Functional | Drug Central | 270 | 1 | 1 | 2 | 3.1 | ClC1=CC=C2NC(=O)CN=C(C3=CC=CC=C3)C2=C1 | None |
Ligands | Receptor | Assay information | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name |
GPCRdb ID | #Vendors | Reference ligand |
Fold selectivity (Affinity) |
# tested GPCRs (Affinity) |
Species | p-value (-log) |
Type | Activity Relation |
Activity Value |
Assay Type | Assay Description | Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI |