Ligand source activities (1 row/activity)
Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name |
GPCRdb ID |
Reference ligand |
Vendors |
Species |
Assay Type |
Activity Type |
Activity Relation |
Activity Value |
p-value (-log) |
Fold selectivity |
Tested GPCRs |
Assay Description |
Source |
Mol weight |
Rot Bonds |
H don |
H acc |
LogP |
Smiles |
DOI |
|
1079 | 901 | None | 34 | Rat | Functional | pEC50 | None | 6.7 | 6.7 | 63 | 4 | Guide to Pharmacology | 292 | 3 | 2 | 2 | 4.5 | OCC(Cc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)(C)C | 11641424 | |||
1079 | 901 | None | 34 | Rat | Functional | pEC50 | None | 6.7 | 6.7 | 63 | 4 | Guide to Pharmacology | 292 | 3 | 2 | 2 | 4.5 | OCC(Cc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)(C)C | 15126507 | |||
5024764 | 901 | None | 34 | Rat | Functional | pEC50 | None | 6.7 | 6.7 | 63 | 4 | Guide to Pharmacology | 292 | 3 | 2 | 2 | 4.5 | OCC(Cc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)(C)C | 11641424 | |||
5024764 | 901 | None | 34 | Rat | Functional | pEC50 | None | 6.7 | 6.7 | 63 | 4 | Guide to Pharmacology | 292 | 3 | 2 | 2 | 4.5 | OCC(Cc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)(C)C | 15126507 | |||
CHEMBL1256697 | 901 | None | 34 | Rat | Functional | pEC50 | None | 6.7 | 6.7 | 63 | 4 | Guide to Pharmacology | 292 | 3 | 2 | 2 | 4.5 | OCC(Cc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)(C)C | 11641424 | |||
CHEMBL1256697 | 901 | None | 34 | Rat | Functional | pEC50 | None | 6.7 | 6.7 | 63 | 4 | Guide to Pharmacology | 292 | 3 | 2 | 2 | 4.5 | OCC(Cc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)(C)C | 15126507 | |||
2997 | 193260 | None | 19 | Human | Functional | pIC50 | = | 8.1 | 8.1 | -13 | 4 | Drug Central | 270 | 1 | 1 | 2 | 3.1 | O=C1CN=C(c2ccccc2)c2cc(Cl)ccc2N1 | None | |||
CHEMBL523 | 193260 | None | 19 | Human | Functional | pIC50 | = | 8.1 | 8.1 | -13 | 4 | Drug Central | 270 | 1 | 1 | 2 | 3.1 | O=C1CN=C(c2ccccc2)c2cc(Cl)ccc2N1 | None |
Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name |
GPCRdb ID |
Reference ligand |
Vendors |
Species |
Assay Type |
Activity Type |
Activity Relation |
Activity Value |
p-value (-log) |
Fold selectivity |
Tested GPCRs |
Assay Description |
Source |
Mol weight |
Rot Bonds |
H don |
H acc |
LogP |
Smiles |
DOI |