fulvestrant
SMILES | O=S(CCCC(C(F)(F)F)(F)F)CCCCCCCCC[C@@H]1Cc2cc(O)ccc2[C@@H]2[C@@H]1[C@@H]1CC[C@@H]([C@]1(CC2)C)O |
InChIKey | VWUXBMIQPBEWFH-WCCTWKNTSA-N |
Chemical properties
Hydrogen bond acceptors | 3 |
Hydrogen bond donors | 2 |
Rotatable bonds | 14 |
Molecular weight (Da) | 606.3 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pKi | 8.44 | 8.44 | 8.44 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pIC50 | 6.78 | 6.78 | 6.78 | Guide to Pharmacology |
mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pIC50 | 6.78 | 6.78 | 6.78 | ChEMBL |