rosiglitazone
SMILES | O=C1NC(=O)C(S1)Cc1ccc(cc1)OCCN(c1ccccn1)C |
InChIKey | YASAKCUCGLMORW-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 6 |
Hydrogen bond donors | 1 |
Rotatable bonds | 7 |
Molecular weight (Da) | 357.1 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 8.9 | 8.9 | 8.9 | Guide to Pharmacology |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 5.2 | 5.2 | 5.2 | ChEMBL |
V2 | V2R | Human | Vasopressin and oxytocin | A | pKi | 6.2 | 6.2 | 6.2 | ChEMBL |
OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 8.9 | 8.9 | 8.9 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |