samidorphan
SMILES | O=C1CC[C@@]2([C@@]3(C1)CCN([C@@H]2Cc1c3c(O)c(cc1)C(=O)N)CC1CC1)O |
InChIKey | RYIDHLJADOKWFM-MAODMQOUSA-N |
Chemical properties
Hydrogen bond acceptors | 5 |
Hydrogen bond donors | 3 |
Rotatable bonds | 3 |
Molecular weight (Da) | 370.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
δ | OPRD | Human | Opioid | A | pKi | 8.59 | 8.59 | 8.59 | Guide to Pharmacology |
κ | OPRK | Human | Opioid | A | pKi | 9.64 | 9.64 | 9.64 | Guide to Pharmacology |
μ | OPRM | Human | Opioid | A | pKi | 10.28 | 10.28 | 10.28 | Guide to Pharmacology |
δ | OPRD | Human | Opioid | A | pKi | 8.59 | 8.59 | 8.59 | ChEMBL |
κ | OPRK | Human | Opioid | A | pKi | 9.64 | 9.64 | 9.64 | ChEMBL |
μ | OPRM | Human | Opioid | A | pKi | 10.28 | 10.28 | 10.28 | ChEMBL |
δ | OPRD | Human | Opioid | A | pKi | 8.07 | 8.07 | 8.07 | Drug Central |
κ | OPRK | Human | Opioid | A | pKi | 8.02 | 8.02 | 8.02 | Drug Central |
μ | OPRM | Human | Opioid | A | pKi | 7.99 | 7.99 | 7.99 | Drug Central |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
δ | OPRD | Human | Opioid | A | pIC50 | 8.16 | 8.16 | 8.16 | ChEMBL |
δ | OPRD | Human | Opioid | A | pEC50 | 8.74 | 8.74 | 8.74 | ChEMBL |
κ | OPRK | Human | Opioid | A | pEC50 | 8.48 | 8.48 | 8.48 | ChEMBL |
κ | OPRK | Human | Opioid | A | pIC50 | 7.42 | 7.42 | 7.42 | ChEMBL |
μ | OPRM | Human | Opioid | A | pIC50 | 9.06 | 9.06 | 9.06 | ChEMBL |