CGP 56999A
SMILES | O[C@H](CP(=O)(CC1CCCCC1)O)CN[C@@H](c1cccc(c1)C(=O)O)C |
InChIKey | JCFULPDIJOVUHP-KDOFPFPSSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 4 |
Rotatable bonds | 9 |
Molecular weight (Da) | 383.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pKi | 6.22 | 6.22 | 6.22 | Guide to Pharmacology |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pKi | 6.22 | 6.22 | 6.22 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pIC50 | 5.82 | 5.82 | 5.82 | Guide to Pharmacology |
mGlu3 | GRM3 | Human | Metabotropic glutamate | C | pEC50 | 5.1 | 5.1 | 5.1 | Guide to Pharmacology |
mGlu3 | GRM3 | Human | Metabotropic glutamate | C | pEC50 | 5.05 | 5.05 | 5.05 | ChEMBL |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pIC50 | 5.82 | 5.82 | 5.82 | ChEMBL |