BAY-545
SMILES | CCn1c(=O)c2c(C)c(sc2n(c1=O)CCC(F)(F)F)C(=O)N1CCC(CC1)O |
InChIKey | NTYVAKNEYLJAPT-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 7 |
Hydrogen bond donors | 1 |
Rotatable bonds | 4 |
Molecular weight (Da) | 433.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
A2B | AA2BR | Human | Adenosine | A | pKi | 7.01 | 7.01 | 7.01 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
A2B | AA2BR | Mouse | Adenosine | A | pIC50 | 6.4 | 6.4 | 6.4 | Guide to Pharmacology |
A2B | AA2BR | Rat | Adenosine | A | pIC50 | 6.55 | 6.55 | 6.55 | Guide to Pharmacology |
A1 | AA1R | Human | Adenosine | A | pIC50 | 5.89 | 5.89 | 5.89 | ChEMBL |
A2A | AA2AR | Human | Adenosine | A | pIC50 | 6.09 | 6.09 | 6.09 | ChEMBL |
A2B | AA2BR | Human | Adenosine | A | pIC50 | 7.18 | 7.21 | 7.23 | ChEMBL |
A2B | AA2BR | Mouse | Adenosine | A | pIC50 | 6.4 | 6.4 | 6.4 | ChEMBL |
A2A | AA2AR | Mouse | Adenosine | A | pIC50 | 6.33 | 6.33 | 6.33 | ChEMBL |
A2B | AA2BR | Rat | Adenosine | A | pIC50 | 6.55 | 6.55 | 6.55 | ChEMBL |
A2A | AA2AR | Rat | Adenosine | A | pIC50 | 6.12 | 6.12 | 6.12 | ChEMBL |