JNJ 7777120
SMILES | CN1CCN(CC1)C(=O)c1cc2c([nH]1)ccc(c2)Cl |
InChIKey | HUQJRYMLJBBEDO-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 2 |
Hydrogen bond donors | 1 |
Rotatable bonds | 1 |
Molecular weight (Da) | 277.1 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Ligand site mutations | H4 |
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
δ | OPRD | Human | Opioid | A | pKi | 9.2 | 9.2 | 9.2 | Guide to Pharmacology |
μ | OPRM | Human | Opioid | A | pKi | 8.7 | 8.7 | 8.7 | Guide to Pharmacology |
δ | OPRD | Mouse | Opioid | A | pKi | 9.1 | 9.1 | 9.1 | Guide to Pharmacology |
δ | OPRD | Human | Opioid | A | pKi | 8.89 | 8.89 | 8.89 | ChEMBL |
μ | OPRM | Rat | Opioid | A | pKi | 7.82 | 8.0 | 8.09 | ChEMBL |
μ | OPRM | Rat | Opioid | A | pKd | 7.66 | 8.36 | 9.05 | ChEMBL |
κ | OPRK | Rat | Opioid | A | pKd | 6.2 | 6.2 | 6.2 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
δ | OPRD | Mouse | Opioid | A | pIC50 | 6.35 | 8.07 | 9.57 | ChEMBL |
δ | OPRD | Human | Opioid | A | pEC50 | 5.86 | 7.94 | 10.7 | ChEMBL |
μ | OPRM | Human | Opioid | A | pEC50 | 5.86 | 6.21 | 6.89 | ChEMBL |
μ | OPRM | Rat | Opioid | A | pIC50 | 7.38 | 7.38 | 7.38 | ChEMBL |
κ | OPRK | Guinea pig | Opioid | A | pIC50 | 5.36 | 7.06 | 8.77 | ChEMBL |