LY 156735
SMILES | COc1cc2c(cc1Cl)[nH]cc2[C@H](CNC(=O)C)C |
InChIKey | RKHCTAKUYDTFHE-QMMMGPOBSA-N |
Chemical properties
Hydrogen bond acceptors | 2 |
Hydrogen bond donors | 2 |
Rotatable bonds | 4 |
Molecular weight (Da) | 280.1 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
B1 | BKRB1 | Human | Bradykinin | A | pKi | 9.6 | 9.8 | 10.0 | Guide to Pharmacology |
B1 | BKRB1 | Human | Bradykinin | A | pKd | 9.4 | 9.4 | 9.4 | Guide to Pharmacology |
B1 | BKRB1 | Mouse | Bradykinin | A | pKi | 8.8 | 8.8 | 8.8 | Guide to Pharmacology |
B1 | BKRB1 | Rat | Bradykinin | A | pKi | 8.7 | 8.8 | 8.9 | Guide to Pharmacology |
B1 | BKRB1 | Human | Bradykinin | A | pKi | 9.66 | 9.66 | 9.66 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
B2 | BKRB2 | Mouse | Bradykinin | A | pIC50 | 4.6 | 4.6 | 4.6 | Guide to Pharmacology |
B1 | BKRB1 | Rat | Bradykinin | A | pEC50 | 7.07 | 7.07 | 7.07 | ChEMBL |
B1 | BKRB1 | Human | Bradykinin | A | pIC50 | 9.06 | 9.06 | 9.06 | ChEMBL |