L-152,804
SMILES | OC1=C(C(=O)CC(C1)(C)C)C1C2=C(Oc3c1cccc3)CC(CC2=O)(C)C |
InChIKey | CCJIUBMPDVWYLU-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 1 |
Rotatable bonds | 1 |
Molecular weight (Da) | 366.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
δ | OPRD | Human | Opioid | A | pKi | 8.8 | 8.8 | 8.8 | Guide to Pharmacology |
κ | OPRK | Human | Opioid | A | pKi | 9.7 | 9.7 | 9.7 | Guide to Pharmacology |
μ | OPRM | Human | Opioid | A | pKi | 9.5 | 9.5 | 9.5 | Guide to Pharmacology |
μ | OPRM | Rat | Opioid | A | pKi | 8.22 | 8.76 | 9.3 | PDSP Ki database |
μ | OPRM | Human | Opioid | A | pKi | 9.59 | 9.59 | 9.59 | PDSP Ki database |
κ | OPRK | Human | Opioid | A | pKi | 9.74 | 9.74 | 9.74 | PDSP Ki database |
δ | A0A286XTF2 | Guinea pig | Opioid | A | pKi | 9.57 | 9.57 | 9.57 | PDSP Ki database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |