IBC 293
SMILES | OC(=O)c1ccc2c(c1)nnn2C(C)C |
InChIKey | RUTVRAJKELSHCC-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 1 |
Rotatable bonds | 2 |
Molecular weight (Da) | 205.1 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pKd | 7.5 | 7.5 | 7.5 | Guide to Pharmacology |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pKd | 7.3 | 7.3 | 7.3 | Guide to Pharmacology |
mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pKi | 8.17 | 8.17 | 8.17 | ChEMBL |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pKi | 6.5 | 6.5 | 6.5 | ChEMBL |
mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pKi | 6.79 | 7.35 | 8.17 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pIC50 | 7.2 | 7.2 | 7.2 | Guide to Pharmacology |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pIC50 | 6.34 | 6.81 | 7.29 | ChEMBL |
mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pIC50 | 6.48 | 7.24 | 7.44 | ChEMBL |