(-)-pentazocine
SMILES | CC(=CCN1CC[C@@]2([C@H]([C@H]1Cc1c2cc(cc1)O)C)C)C |
InChIKey | VOKSWYLNZZRQPF-GDIGMMSISA-N |
Chemical properties
Hydrogen bond acceptors | 2 |
Hydrogen bond donors | 1 |
Rotatable bonds | 2 |
Molecular weight (Da) | 285.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
δ | OPRD | Human | Opioid | A | pKi | 7.3 | 7.3 | 7.3 | Guide to Pharmacology |
κ | OPRK | Human | Opioid | A | pKi | 7.8 | 8.2 | 8.6 | Guide to Pharmacology |
μ | OPRM | Human | Opioid | A | pKi | 8.4 | 8.4 | 8.4 | Guide to Pharmacology |
κ | OPRK | Human | Opioid | A | pKi | 8.66 | 8.66 | 8.66 | ChEMBL |
μ | OPRM | Human | Opioid | A | pKi | 8.41 | 8.41 | 8.41 | ChEMBL |
μ | OPRM | Human | Opioid | A | pKi | 8.16 | 8.33 | 8.41 | PDSP Ki database |
δ | OPRD | Human | Opioid | A | pKi | 6.74 | 7.12 | 7.31 | PDSP Ki database |
κ | OPRK | Human | Opioid | A | pKi | 8.52 | 8.61 | 8.66 | PDSP Ki database |
κ | OPRK | Guinea pig | Opioid | A | pKi | 8.36 | 8.36 | 8.36 | PDSP Ki database |
δ | A0A286XTF2 | Guinea pig | Opioid | A | pKi | 7.49 | 7.49 | 7.49 | PDSP Ki database |
κ | OPRK | Human | Opioid | A | pKi | 8.06 | 8.06 | 8.06 | Drug Central |
μ | OPRM | Human | Opioid | A | pKi | 8.08 | 8.08 | 8.08 | Drug Central |
μ | OPRM | Rat | Opioid | A | pKi | 8.09 | 8.09 | 8.09 | Drug Central |
κ | OPRK | Guinea pig | Opioid | A | pKi | 8.15 | 8.15 | 8.15 | Drug Central |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
δ | OPRD | Human | Opioid | A | pEC50 | 8.14 | 8.14 | 8.14 | Drug Central |