7α-NHEt-ginkgolide B
SMILES | CCN[C@H]1C(C(C)(C)C)C23C45C1OC(=O)[C@@]5(OC2OC(=O)[C@@H]3O)[C@@]1([C@H](C4O)OC(=O)C1C)O |
InChIKey | UIERCQIWSNGSNJ-YUTHRBKVSA-N |
Chemical properties
Hydrogen bond acceptors | 11 |
Hydrogen bond donors | 4 |
Rotatable bonds | 2 |
Molecular weight (Da) | 467.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
ghrelin | GHSR | Human | Ghrelin | A | pIC50 | 8.4 | 8.4 | 8.4 | Guide to Pharmacology |
ghrelin | GHSR | Rat | Ghrelin | A | pKB | 8.0 | 8.0 | 8.0 | Guide to Pharmacology |
ghrelin | GHSR | Human | Ghrelin | A | pIC50 | 8.4 | 8.4 | 8.4 | ChEMBL |