SC-51089
SMILES | O=C(NNC(=O)N1Cc2ccccc2Oc2c1cc(Cl)cc2)CCc1ccncc1 |
InChIKey | XDJPQOUDGROSEU-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 2 |
Rotatable bonds | 3 |
Molecular weight (Da) | 422.1 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
κ | OPRK | Human | Opioid | A | pKi | 6.59 | 6.59 | 6.59 | Guide to Pharmacology |
μ | OPRM | Human | Opioid | A | pKi | 8.7 | 8.7 | 8.7 | Guide to Pharmacology |
κ | OPRK | Human | Opioid | A | pKi | 6.58 | 6.58 | 6.58 | ChEMBL |
κ | OPRK | Human | Opioid | A | pKi | 8.18 | 8.18 | 8.18 | Drug Central |
μ | OPRM | Human | Opioid | A | pKi | 8.1 | 8.1 | 8.1 | Drug Central |
μ | OPRM | Human | Opioid | A | pKi | 8.02 | 8.02 | 8.02 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |