ONO-AE3-240
SMILES | CC(CC(c1cccc2c1cccc2)C(=O)Nc1cc(ccc1Cc1ccccc1C(=O)O)Cn1cccn1)C |
InChIKey | WXTQSWUTEXDKIF-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 2 |
Rotatable bonds | 10 |
Molecular weight (Da) | 531.3 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
β2 | ADRB2 | Human | Adrenoceptors | A | pKi | 9.2 | 9.35 | 9.5 | Guide to Pharmacology |
β3 | ADRB3 | Human | Adrenoceptors | A | pKi | 5.8 | 6.2 | 6.6 | Guide to Pharmacology |
β1 | ADRB1 | Human | Adrenoceptors | A | pKd | 6.74 | 6.74 | 6.74 | ChEMBL |
β2 | ADRB2 | Human | Adrenoceptors | A | pKd | 6.2 | 8.44 | 9.61 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
β2 | ADRB2 | Human | Adrenoceptors | A | pIC50 | 9.13 | 9.13 | 9.13 | ChEMBL |
TSH | TSHR | Human | Glycoprotein hormone | A | Potency | 4.4 | 4.4 | 4.4 | ChEMBL |