quinine
SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@@H](c1ccnc2c1cc(OC)cc2)O |
InChIKey | LOUPRKONTZGTKE-WZBLMQSHSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 1 |
Rotatable bonds | 4 |
Molecular weight (Da) | 324.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
H1 | HRH1 | Human | Histamine | A | pKi | 5.0 | 5.0 | 5.0 | Guide to Pharmacology |
H2 | HRH2 | Human | Histamine | A | pKi | 5.0 | 5.0 | 5.0 | Guide to Pharmacology |
H3 | HRH3 | Human | Histamine | A | pKi | 8.485 | 8.48 | 8.48 | Guide to Pharmacology |
H4 | HRH4 | Human | Histamine | A | pKi | 5.0 | 5.0 | 5.0 | Guide to Pharmacology |
H3 | HRH3 | Human | Histamine | A | pKi | 8.17 | 8.72 | 9.28 | ChEMBL |
H3 | HRH3 | Human | Histamine | A | pKd | 9.2 | 9.2 | 9.2 | ChEMBL |
H3 | HRH3 | Rat | Histamine | A | pKi | 7.48 | 7.48 | 7.48 | ChEMBL |
H3 | Q865E1 | Rhesus macaque | Histamine | A | pKi | 8.37 | 8.37 | 8.37 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
H3 | HRH3 | Human | Histamine | A | pIC50 | 8.77 | 8.77 | 8.77 | ChEMBL |