SB 203186
SMILES | O=C(c1c[nH]c2c1cccc2)OCCN1CCCCC1 |
InChIKey | YGKPIROTKVQCCU-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 3 |
Hydrogen bond donors | 1 |
Rotatable bonds | 4 |
Molecular weight (Da) | 272.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
PAC1 | PACR | Rat | VIP and PACAP | B1 | pKi | 8.15 | 8.15 | 8.15 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
PAC1 | PACR | Human | VIP and PACAP | B1 | pIC50 | 8.52 | 8.52 | 8.52 | ChEMBL |
PAC1 | PACR | Human | VIP and PACAP | B1 | pEC50 | 9.89 | 9.89 | 9.89 | ChEMBL |
VPAC1 | VIPR1 | Human | VIP and PACAP | B1 | pIC50 | 7.92 | 7.92 | 7.92 | ChEMBL |
VPAC1 | VIPR1 | Human | VIP and PACAP | B1 | pEC50 | 9.22 | 9.22 | 9.22 | ChEMBL |
VPAC2 | VIPR2 | Human | VIP and PACAP | B1 | pIC50 | 7.89 | 7.89 | 7.89 | ChEMBL |
VPAC2 | VIPR2 | Human | VIP and PACAP | B1 | pEC50 | 10.06 | 10.06 | 10.06 | ChEMBL |