ipratropium
| SMILES | OCC(c1ccccc1)C(=O)OC1CC2CCC(C1)[N+]2(C)C(C)C |
| InChIKey | OEXHQOGQTVQTAT-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 3 |
| Hydrogen bond donors | 1 |
| Rotatable bonds | 5 |
| Molecular weight (Da) | 332.2 |
Drug properties
| Molecular type | Small molecule |
| Endogenous/Surrogate | Surrogate |
| Approved drug | Yes |
Database connections
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| VPAC1 | VIPR1 | Human | VIP and PACAP | B1 | pKi | 8.1 | 8.1 | 8.1 | Guide to Pharmacology |
| VPAC2 | VIPR2 | Human | VIP and PACAP | B1 | pKi | 5.6 | 5.6 | 5.6 | Guide to Pharmacology |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| PAC1 | PACR | Human | VIP and PACAP | B1 | pEC50 | 5.4 | 5.4 | 5.4 | Guide to Pharmacology |
| VPAC1 | VIPR1 | Human | VIP and PACAP | B1 | pEC50 | 9.066666666666665 | 9.07 | 9.07 | Guide to Pharmacology |
| VPAC2 | VIPR2 | Human | VIP and PACAP | B1 | pEC50 | 5.3 | 5.3 | 5.3 | Guide to Pharmacology |