zafirlukast
SMILES | COc1cc(ccc1Cc1cn(c2c1cc(cc2)NC(=O)OC1CCCC1)C)C(=O)NS(=O)(=O)c1ccccc1C |
InChIKey | YEEZWCHGZNKEEK-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 7 |
Hydrogen bond donors | 2 |
Rotatable bonds | 8 |
Molecular weight (Da) | 575.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Structure pdb | 6RZ5 |
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
CysLT1 | CLTR1 | Human | Leukotriene | A | pKi | 8.9 | 8.9 | 8.9 | Guide to Pharmacology |
CysLT1 | CLTR1 | Guinea pig | Leukotriene | A | pKi | 8.64 | 9.2 | 9.52 | ChEMBL |
CysLT1 | CLTR1 | Human | Leukotriene | A | pKi | 9.06 | 9.06 | 9.06 | ChEMBL |
A3 | AA3R | Human | Adenosine | A | pKi | 6.11 | 6.11 | 6.11 | ChEMBL |
BLT1 | LT4R1 | Human | Leukotriene | A | pKi | 5.15 | 5.15 | 5.15 | PDSP Ki database |
BLT2 | LT4R2 | Human | Leukotriene | A | pKi | 5.0 | 5.0 | 5.0 | PDSP Ki database |
CysLT1 | CLTR1 | Human | Leukotriene | A | pKi | 9.59 | 9.59 | 9.59 | PDSP Ki database |
CysLT2 | CLTR2 | Human | Leukotriene | A | pKi | 6.0 | 6.0 | 6.0 | PDSP Ki database |
BLT1 | LT4R1 | Human | Leukotriene | A | pKi | 8.29 | 8.29 | 8.29 | Drug Central |
CysLT1 | CLTR1 | Human | Leukotriene | A | pKi | 8.02 | 8.02 | 8.02 | Drug Central |
A3 | AA3R | Human | Adenosine | A | pKi | 8.21 | 8.21 | 8.21 | Drug Central |
CysLT1 | CLTR1 | Guinea pig | Leukotriene | A | pKi | 8.02 | 8.02 | 8.02 | Drug Central |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
CysLT1 | CLTR1 | Human | Leukotriene | A | pIC50 | 8.59 | 8.65 | 8.74 | Guide to Pharmacology |
CysLT2 | CLTR2 | Human | Leukotriene | A | pIC50 | 5.140000000000001 | 5.14 | 5.14 | Guide to Pharmacology |
CysLT2 | CLTR2 | Human | Leukotriene | A | pA2 | 6.9 | 6.9 | 6.9 | Guide to Pharmacology |
CysLT2 | CLTR2 | Human | Leukotriene | A | pIC50 | 4.24 | 4.69 | 5.13 | ChEMBL |
CysLT1 | CLTR1 | Guinea pig | Leukotriene | A | pIC50 | 7.36 | 8.47 | 9.36 | ChEMBL |
CysLT1 | CLTR1 | Human | Leukotriene | A | pIC50 | 7.85 | 8.73 | 9.59 | ChEMBL |
A3 | AA3R | Human | Adenosine | A | pIC50 | 5.87 | 5.87 | 5.87 | ChEMBL |
CysLT2 | CLTR2 | Human | Leukotriene | A | pIC50 | 8.29 | 8.29 | 8.29 | Drug Central |
NPS | NPSR1 | Human | Neuropeptide S | A | Potency | 5.0 | 5.0 | 5.0 | ChEMBL |