N-desmethylclozapine
SMILES | Clc1ccc2c(c1)NC(=c1c(=N2)cccc1)N1CCNCC1 |
InChIKey | HESZUPIXRNZIOI-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 2 |
Rotatable bonds | 1 |
Molecular weight (Da) | 312.1 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Y1 | NPY1R | Human | Neuropeptide Y | A | pIC50 | 6.0 | 6.0 | 6.0 | Guide to Pharmacology |
Y2 | NPY2R | Human | Neuropeptide Y | A | pIC50 | 6.1 | 6.1 | 6.1 | Guide to Pharmacology |
Y4 | NPY4R | Human | Neuropeptide Y | A | pIC50 | 6.0 | 6.0 | 6.0 | Guide to Pharmacology |
Y5 | NPY5R | Human | Neuropeptide Y | A | pIC50 | 8.2 | 8.2 | 8.2 | Guide to Pharmacology |
Y5 | NPY5R | Rat | Neuropeptide Y | A | pIC50 | 8.2 | 8.2 | 8.2 | Guide to Pharmacology |