chlordiazepoxide
SMILES | CNC1=Nc2ccc(cc2C(=[N+](C1)[O-])c1ccccc1)Cl |
InChIKey | ANTSCNMPPGJYLG-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 3 |
Hydrogen bond donors | 1 |
Rotatable bonds | 1 |
Molecular weight (Da) | 299.1 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
MT1 | MTR1A | Human | Melatonin | A | pKi | 8.4 | 8.85 | 9.3 | Guide to Pharmacology |
MT2 | MTR1B | Human | Melatonin | A | pKi | 6.8 | 6.9 | 7.0 | Guide to Pharmacology |
MT2 | MTR1B | Human | Melatonin | A | pKi | 6.45 | 6.83 | 6.95 | ChEMBL |
MT1 | MTR1A | Human | Melatonin | A | pKi | 6.95 | 8.37 | 9.3 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |