zinterol
SMILES | OC(c1ccc(c(c1)NS(=O)(=O)C)O)CNC(Cc1ccccc1)(C)C |
InChIKey | XJBCFFLVLOPYBV-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 5 |
Hydrogen bond donors | 4 |
Rotatable bonds | 8 |
Molecular weight (Da) | 378.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
UT | UR2R | Human | Urotensin | A | pKi | 8.0 | 8.0 | 8.0 | Guide to Pharmacology |
UT | UR2R | Mouse | Urotensin | A | pKi | 7.7 | 7.7 | 7.7 | Guide to Pharmacology |
UT | UR2R | Rat | Urotensin | A | pKi | 7.7 | 7.7 | 7.7 | Guide to Pharmacology |
UT | UR2R | Human | Urotensin | A | pKi | 8.1 | 8.18 | 8.27 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
UT | UR2R | Rat | Urotensin | A | pIC50 | 7.47 | 7.47 | 7.47 | ChEMBL |
UT | UR2R | Human | Urotensin | A | pIC50 | 7.85 | 8.06 | 8.22 | ChEMBL |