strychnine
SMILES | O=C1C[C@@H]2OCC=C3[C@H]4[C@@H]2[C@@H]2N1c1ccccc1[C@]12CCN([C@H]1C4)C3 |
InChIKey | QMGVPVSNSZLJIA-FVWCLLPLSA-N |
Chemical properties
Hydrogen bond acceptors | 3 |
Hydrogen bond donors | 0 |
Rotatable bonds | 0 |
Molecular weight (Da) | 334.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Structure pdb | 7XP6 |
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
CRF1 | CRFR1 | Human | Corticotropin-releasing factor | B1 | pKd | 7.3 | 7.55 | 7.8 | Guide to Pharmacology |
CRF2 | CRFR2 | Mouse | Corticotropin-releasing factor | B1 | pKd | 9.0 | 9.05 | 9.1 | Guide to Pharmacology |
CRF2 | CRFR2 | Rat | Corticotropin-releasing factor | B1 | pKd | 8.3 | 8.35 | 8.4 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |