relcovaptan
SMILES | COc1ccc(cc1OC)S(=O)(=O)N1c2ccc(cc2[C@]([C@@H]1C(=O)N1CCC[C@H]1C(=O)N)(O)c1ccccc1Cl)Cl |
InChIKey | CEBYCSRFKCEUSW-NAYZPBBASA-N |
Chemical properties
Hydrogen bond acceptors | 7 |
Hydrogen bond donors | 2 |
Rotatable bonds | 7 |
Molecular weight (Da) | 619.1 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
BLT1 | LT4R1 | Human | Leukotriene | A | pKi | 6.55 | 6.61 | 6.66 | ChEMBL |
BLT1 | LT4R1 | Human | Leukotriene | A | pKi | 7.77 | 7.77 | 7.77 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
BLT1 | LT4R1 | Human | Leukotriene | A | pIC50 | 6.5 | 7.12 | 9.0 | ChEMBL |
BLT1 | LT4R1 | Human | Leukotriene | A | pIC50 | 6.1 | 6.1 | 6.1 | Guide to Pharmacology |