BAY27-9955
SMILES | CCCc1c(cc(c(c1c1ccc(cc1)F)C(O)C)C(C)C)C(C)C |
InChIKey | VDTWKXAPIQBOMO-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 1 |
Hydrogen bond donors | 1 |
Rotatable bonds | 6 |
Molecular weight (Da) | 342.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
NOP | OPRX | Human | Opioid | A | pKi | 9.52 | 9.52 | 9.52 | ChEMBL |
δ | OPRD | Human | Opioid | A | pKi | 5.54 | 5.54 | 5.54 | ChEMBL |
δ | OPRD | Human | Opioid | A | pKi | 5.54 | 5.54 | 5.54 | Guide to Pharmacology |
κ | OPRK | Human | Opioid | A | pKi | 6.88 | 6.88 | 6.88 | ChEMBL |
κ | OPRK | Human | Opioid | A | pKi | 6.88 | 6.88 | 6.88 | Guide to Pharmacology |
μ | OPRM | Human | Opioid | A | pKi | 7.19 | 7.19 | 7.19 | ChEMBL |
μ | OPRM | Human | Opioid | A | pKi | 7.19 | 7.19 | 7.19 | Guide to Pharmacology |
NOP | OPRX | Human | Opioid | A | pKi | 9.52 | 9.52 | 9.52 | Guide to Pharmacology |
NOP | OPRX | Rat | Opioid | A | pKi | 9.38 | 9.38 | 9.38 | Guide to Pharmacology |
NOP | OPRX | Mouse | Opioid | A | pKi | 8.94 | 8.94 | 8.94 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
NOP | OPRX | Human | Opioid | A | pEC50 | 7.92 | 7.92 | 7.92 | ChEMBL |
μ | OPRM | Human | Opioid | A | pEC50 | 6.16 | 6.16 | 6.16 | ChEMBL |
NOP | OPRX | Human | Opioid | A | pEC50 | 7.92 | 7.92 | 7.92 | Guide to Pharmacology |