sufentanil
SMILES | COCC1(CCN(CC1)CCc1cccs1)N(c1ccccc1)C(=O)CC |
InChIKey | GGCSSNBKKAUURC-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 0 |
Rotatable bonds | 8 |
Molecular weight (Da) | 386.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
μ | OPRM | Human | Opioid | A | pKi | 9.9 | 9.9 | 9.9 | Guide to Pharmacology |
μ | OPRM | Rat | Opioid | A | pKi | 9.1 | 9.1 | 9.1 | Guide to Pharmacology |
μ | OPRM | Rat | Opioid | A | pKi | 9.66 | 9.66 | 9.66 | ChEMBL |
δ | OPRD | Human | Opioid | A | pKi | 7.3 | 7.3 | 7.3 | PDSP Ki database |
κ | OPRK | Human | Opioid | A | pKi | 7.12 | 7.12 | 7.12 | PDSP Ki database |
μ | OPRM | Human | Opioid | A | pKi | 9.52 | 9.67 | 9.82 | PDSP Ki database |
δ | OPRD | Human | Opioid | A | pKi | 8.14 | 8.14 | 8.14 | Drug Central |
μ | OPRM | Rat | Opioid | A | pKi | 8.02 | 8.02 | 8.02 | Drug Central |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
μ | OPRM | Rat | Opioid | A | pIC50 | 9.4 | 9.4 | 9.4 | ChEMBL |
μ | OPRM | Human | Opioid | A | pEC50 | 8.82 | 8.86 | 8.89 | ChEMBL |
κ | OPRK | Human | Opioid | A | pEC50 | 8.17 | 8.17 | 8.17 | Drug Central |
μ | OPRM | Human | Opioid | A | pEC50 | 8.09 | 8.09 | 8.09 | Drug Central |