VNA932
SMILES | Cc1ccn(n1)c1ccc(c(c1)Cl)C(=O)N1Cc2cccn2Cc2c1cccc2 |
InChIKey | JXKQHDZUZGKDGO-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 0 |
Rotatable bonds | 2 |
Molecular weight (Da) | 402.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 6.7 | 6.77 | 6.9 | ChEMBL |
V2 | V2R | Human | Vasopressin and oxytocin | A | pKi | 7.3 | 7.33 | 7.4 | ChEMBL |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 6.33 | 6.42 | 6.46 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
V2 | V2R | Human | Vasopressin and oxytocin | A | pIC50 | 7.1 | 7.1 | 7.1 | Guide to Pharmacology |
OT | OXYR | Rat | Vasopressin and oxytocin | A | pIC50 | 7.26 | 7.26 | 7.26 | ChEMBL |
OT | OXYR | Human | Vasopressin and oxytocin | A | pIC50 | 6.45 | 6.45 | 6.45 | ChEMBL |
OT | OXYR | Human | Vasopressin and oxytocin | A | pEC50 | 6.9 | 6.9 | 6.9 | ChEMBL |
V2 | V2R | Human | Vasopressin and oxytocin | A | pIC50 | 7.09 | 7.09 | 7.1 | ChEMBL |
V2 | V2R | Human | Vasopressin and oxytocin | A | pEC50 | 7.4 | 8.56 | 9.15 | ChEMBL |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pIC50 | 5.78 | 6.0 | 6.11 | ChEMBL |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pEC50 | 6.33 | 6.33 | 6.33 | ChEMBL |