W-84
SMILES | O=C1N(CCC[N+](CCCCCC[N+](CCCN2C(=O)c3c(C2=O)cccc3)(C)C)(C)C)C(=O)c2c1cccc2 |
InChIKey | WDAXQFXYXWPELC-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 0 |
Rotatable bonds | 15 |
Molecular weight (Da) | 548.3 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu7 | GRM7 | Human | Metabotropic glutamate | C | pKi | 4.4 | 4.4 | 4.4 | Guide to Pharmacology |
mGlu2 | GRM2 | Rat | Metabotropic glutamate | C | pKi | 5.3 | 5.3 | 5.3 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu6 | GRM6 | Rat | Metabotropic glutamate | C | pEC50 | 4.1 | 4.1 | 4.1 | Guide to Pharmacology |
mGlu8 | GRM8 | Rat | Metabotropic glutamate | C | pIC50 | 5.3 | 5.3 | 5.3 | Guide to Pharmacology |