MRS1177
SMILES | Clc1ccc2c(c1)c1nc(nn1c(n2)NC(=O)c1ccccc1)c1ccco1 |
InChIKey | XIEBLXLGWFCYEP-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 6 |
Hydrogen bond donors | 1 |
Rotatable bonds | 3 |
Molecular weight (Da) | 389.1 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
TAS2R14 | T2R14 | Human | Taste 2 | T | pEC50 | 6.31 | 6.31 | 6.31 | Guide to Pharmacology |
TAS2R31 | T2R31 | Human | Taste 2 | T | pEC50 | 6.35 | 6.35 | 6.35 | Guide to Pharmacology |
TAS2R43 | T2R43 | Human | Taste 2 | T | pEC50 | 7.1 | 7.1 | 7.1 | Guide to Pharmacology |