T-0509
SMILES | COc1cc(CCNCC(c2ccc(c(c2)O)O)O)ccc1OC |
InChIKey | DIPGFXJERHNAQQ-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 6 |
Hydrogen bond donors | 4 |
Rotatable bonds | 8 |
Molecular weight (Da) | 333.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
PAR2 | PAR2 | Human | Proteinase-activated | A | pKd | 7.87 | 7.87 | 7.87 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
PAR2 | PAR2 | Human | Proteinase-activated | A | pIC50 | 7.955 | 7.96 | 7.96 | Guide to Pharmacology |
PAR2 | PAR2 | Human | Proteinase-activated | A | pIC50 | 5.18 | 5.18 | 5.18 | ChEMBL |
PAR4 | PAR4 | Human | Proteinase-activated | A | pIC50 | 6.42 | 6.42 | 6.42 | ChEMBL |