bag-2
SMILES | OC(=O)c1ccccc1c1ccc(cc1)CCc1ncc([nH]1)CC1CCCC1 |
InChIKey | OENIXTHWZWFYIV-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 2 |
Hydrogen bond donors | 2 |
Rotatable bonds | 7 |
Molecular weight (Da) | 374.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
BB3 | BRS3 | Mouse | Bombesin | A | pKd | 8.59 | 8.59 | 8.59 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
BB3 | BRS3 | Human | Bombesin | A | pIC50 | 7.02 | 7.02 | 7.02 | Guide to Pharmacology |
BB3 | BRS3 | Mouse | Bombesin | A | pIC50 | 8.18 | 8.18 | 8.18 | Guide to Pharmacology |
BB3 | BRS3 | Human | Bombesin | A | pEC50 | 6.88 | 6.88 | 6.88 | ChEMBL |
BB3 | BRS3 | Mouse | Bombesin | A | pEC50 | 8.1 | 8.1 | 8.1 | ChEMBL |
BB3 | BRS3 | Rat | Bombesin | A | pIC50 | 7.99 | 7.99 | 7.99 | Guide to Pharmacology |