hydromorphone
SMILES | O=C1CC[C@@H]2[C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)C)ccc1O |
InChIKey | WVLOADHCBXTIJK-YNHQPCIGSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 1 |
Rotatable bonds | 0 |
Molecular weight (Da) | 285.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
δ | OPRD | Human | Opioid | A | pKi | 7.42 | 7.42 | 7.42 | ChEMBL |
κ | OPRK | Human | Opioid | A | pKi | 8.55 | 8.55 | 8.55 | ChEMBL |
μ | OPRM | Human | Opioid | A | pKi | 9.55 | 9.55 | 9.55 | ChEMBL |
δ | OPRD | Human | Opioid | A | pKi | 8.13 | 8.13 | 8.13 | Drug Central |
δ | OPRD | Human | Opioid | A | pKi | 7.42 | 7.42 | 7.42 | Guide to Pharmacology |
κ | OPRK | Human | Opioid | A | pKi | 8.07 | 8.07 | 8.07 | Drug Central |
κ | OPRK | Human | Opioid | A | pKi | 8.55 | 8.55 | 8.55 | Guide to Pharmacology |
μ | OPRM | Human | Opioid | A | pKi | 8.02 | 8.02 | 8.02 | Drug Central |
μ | OPRM | Human | Opioid | A | pKi | 9.55 | 9.55 | 9.55 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
κ | OPRK | Human | Opioid | A | pEC50 | 7.96 | 7.96 | 7.96 | ChEMBL |
μ | OPRM | Human | Opioid | A | pEC50 | 8.59 | 8.59 | 8.59 | ChEMBL |