L-citrulline
SMILES | NC(=O)NCCC[C@@H](C(=O)O)N |
InChIKey | RHGKLRLOHDJJDR-BYPYZUCNSA-N |
Chemical properties
Hydrogen bond acceptors | 3 |
Hydrogen bond donors | 4 |
Rotatable bonds | 5 |
Molecular weight (Da) | 175.1 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Endogenous |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
LPA1 | LPAR1 | Human | Lysophospholipid (LPA) | A | pKi | 6.09 | 6.09 | 6.09 | Guide to Pharmacology |
LPA2 | LPAR2 | Mouse | Lysophospholipid (LPA) | A | pKi | 6.61 | 6.61 | 6.61 | Guide to Pharmacology |
LPA2 | LPAR2 | Human | Lysophospholipid (LPA) | A | pKi | 6.77 | 6.77 | 6.77 | ChEMBL |
LPA1 | LPAR1 | Human | Lysophospholipid (LPA) | A | pKi | 6.77 | 6.77 | 6.77 | ChEMBL |
LPA3 | LPAR3 | Human | Lysophospholipid (LPA) | A | pKi | 6.77 | 6.77 | 6.77 | ChEMBL |
LPA4 | LPAR4 | Human | Lysophospholipid (LPA) | A | pKi | 6.77 | 6.77 | 6.77 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
LPA1 | LPAR1 | Human | Lysophospholipid (LPA) | A | pIC50 | 5.34 | 5.34 | 5.34 | Guide to Pharmacology |
LPA2 | LPAR2 | Mouse | Lysophospholipid (LPA) | A | pIC50 | 6.33 | 6.33 | 6.33 | Guide to Pharmacology |