SB 272183
SMILES | CN1CCN(CC1)c1cc2c(cc1Cl)CCN2C(=O)Nc1ccc(c2c1cccc2)c1ccncc1 |
InChIKey | DAPBIPAGJXKFCI-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 1 |
Rotatable bonds | 3 |
Molecular weight (Da) | 497.2 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
P2Y1 | P2RY1 | Human | P2Y | A | pKd | 7.3 | 7.3 | 7.3 | Guide to Pharmacology |
P2Y12 | P2Y12 | Human | P2Y | A | pKi | 9.2 | 9.2 | 9.2 | Guide to Pharmacology |
P2Y12 | P2Y12 | Human | P2Y | A | pKi | 7.49 | 7.49 | 7.49 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
P2Y1 | P2RY1 | Human | P2Y | A | pIC50 | 5.4 | 6.2 | 7.0 | Guide to Pharmacology |
P2Y12 | P2Y12 | Human | P2Y | A | pIC50 | 7.5 | 8.55 | 9.6 | Guide to Pharmacology |
P2Y13 | P2Y13 | Human | P2Y | A | pIC50 | 9.0 | 9.0 | 9.0 | Guide to Pharmacology |
P2Y1 | P2RY1 | Rat | P2Y | A | pEC50 | 7.0 | 7.0 | 7.0 | ChEMBL |
P2Y1 | P2RY1 | Wild turkey | P2Y | A | pEC50 | 8.22 | 8.41 | 8.6 | ChEMBL |
P2Y1 | P2RY1 | Human | P2Y | A | pEC50 | 4.76 | 7.52 | 8.9 | ChEMBL |
P2Y1 | P2RY1 | Human | P2Y | A | pIC50 | 6.44 | 7.09 | 7.66 | ChEMBL |