Sch.336
SMILES | COc1ccc(c(c1)S(=O)(=O)c1ccc(cc1)OC)S(=O)(=O)c1ccc(cc1)[C@@H](NS(=O)(=O)C)C |
InChIKey | NXODIUKWAVUFGF-INIZCTEOSA-N |
Chemical properties
Hydrogen bond acceptors | 8 |
Hydrogen bond donors | 1 |
Rotatable bonds | 9 |
Molecular weight (Da) | 539.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
CB1 | CNR1 | Human | Cannabinoid | A | pKi | 6.04 | 6.04 | 6.04 | Guide to Pharmacology |
CB2 | CNR2 | Human | Cannabinoid | A | pKi | 9.07 | 9.07 | 9.07 | Guide to Pharmacology |
CB2 | CNR2 | Human | Cannabinoid | A | pKi | 8.35 | 8.88 | 9.4 | ChEMBL |
CB1 | CNR1 | Human | Cannabinoid | A | pKi | 6.04 | 6.57 | 7.1 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
CB1 | CNR1 | Human | Cannabinoid | A | pEC50 | 6.7 | 6.7 | 6.7 | Guide to Pharmacology |