Ligand source activities (1 row/activity)
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name |
GPCRdb ID |
#Vendors |
Reference ligand |
Fold selectivity |
# Tested GPCRs |
Species |
p-value (-log) |
Activity Type |
Activity Relation |
Activity Value |
AssayType |
Assay Description |
Source |
Mol weight |
Rot Bonds |
H don |
H acc |
LogP |
Smiles |
DOI |
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Similar- ity |
Common name |
GPCRdb ID |
#Vendors |
Reference ligand |
Fold selectivity |
# Tested GPCRs |
Species |
p-value (-log) |
Activity Type |
Activity Relation |
Activity Value |
Assay Type |
Assay Description |
Source |
Mol weight |
Rot Bonds |
H don |
H acc |
LogP |
Smiles |
DOI |
| 125957 | 120160 | 8 | None | 1 | 2 | Rat | 7.2 | pKi | = | 7.2 | Binding | ChEMBL | 256 | 0 | 1 | 2 | 2.4 | FC(F)(F)c1ccc2c(c1)N1CCNCC1CC2 | 10.1016/S0960-894X(97)00074-7 | |||
| CHEMBL351530 | 120160 | 8 | None | 1 | 2 | Rat | 7.2 | pKi | = | 7.2 | Binding | ChEMBL | 256 | 0 | 1 | 2 | 2.4 | FC(F)(F)c1ccc2c(c1)N1CCNCC1CC2 | 10.1016/S0960-894X(97)00074-7 | |||