Ligand source activities (1 row/activity)
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
| 6120 | 1741 | None | 0 | Rat | Functional | pEC50 | = | 7.5 | 7.5 | -15 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 10601261 | ||||
| 16133243 | 1715 | None | 0 | Rat | Functional | pEC50 | = | 9.8 | 9.8 | -1 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 10601261 | ||||
| 3593 | 1715 | None | 0 | Rat | Functional | pEC50 | = | 9.8 | 9.8 | -1 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 10601261 | ||||
| 155817484 | 1714 | None | 0 | Rat | Functional | pIC50 | = | 10.2 | 10.2 | 2 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9108306 | ||||
| 155817484 | 1714 | None | 0 | Rat | Functional | pIC50 | = | 10.2 | 10.2 | 2 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9168941 | ||||
| 6117 | 1714 | None | 0 | Rat | Functional | pIC50 | = | 10.2 | 10.2 | 2 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9108306 | ||||
| 6117 | 1714 | None | 0 | Rat | Functional | pIC50 | = | 10.2 | 10.2 | 2 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9168941 | ||||
| 6129 | 1714 | None | 0 | Rat | Functional | pIC50 | = | 10.2 | 10.2 | 2 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9108306 | ||||
| 6129 | 1714 | None | 0 | Rat | Functional | pIC50 | = | 10.2 | 10.2 | 2 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9168941 | ||||
| 101927062 | 1716 | None | 20 | Rat | Functional | pIC50 | = | 10.2 | 10.2 | 1 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9108306 | ||||
| 101927062 | 1716 | None | 20 | Rat | Functional | pIC50 | = | 10.2 | 10.2 | 1 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9168941 | ||||
| 155817445 | 1716 | None | 20 | Rat | Functional | pIC50 | = | 10.2 | 10.2 | 1 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9108306 | ||||
| 155817445 | 1716 | None | 20 | Rat | Functional | pIC50 | = | 10.2 | 10.2 | 1 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9168941 | ||||
| 16133823 | 1716 | None | 20 | Rat | Functional | pIC50 | = | 10.2 | 10.2 | 1 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9108306 | ||||
| 16133823 | 1716 | None | 20 | Rat | Functional | pIC50 | = | 10.2 | 10.2 | 1 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9168941 | ||||
| 3592 | 1716 | None | 20 | Rat | Functional | pIC50 | = | 10.2 | 10.2 | 1 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9108306 | ||||
| 3592 | 1716 | None | 20 | Rat | Functional | pIC50 | = | 10.2 | 10.2 | 1 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9168941 | ||||
| 44584852 | 1716 | None | 20 | Rat | Functional | pIC50 | = | 10.2 | 10.2 | 1 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9108306 | ||||
| 44584852 | 1716 | None | 20 | Rat | Functional | pIC50 | = | 10.2 | 10.2 | 1 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9168941 | ||||
| 6090 | 1716 | None | 20 | Rat | Functional | pIC50 | = | 10.2 | 10.2 | 1 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9108306 | ||||
| 6090 | 1716 | None | 20 | Rat | Functional | pIC50 | = | 10.2 | 10.2 | 1 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9168941 | ||||
| 91898917 | 1716 | None | 20 | Rat | Functional | pIC50 | = | 10.2 | 10.2 | 1 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9108306 | ||||
| 91898917 | 1716 | None | 20 | Rat | Functional | pIC50 | = | 10.2 | 10.2 | 1 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9168941 | ||||
| CHEMBL506553 | 1716 | None | 20 | Rat | Functional | pIC50 | = | 10.2 | 10.2 | 1 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9108306 | ||||
| CHEMBL506553 | 1716 | None | 20 | Rat | Functional | pIC50 | = | 10.2 | 10.2 | 1 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9168941 | ||||
| 3898 | 2446 | None | 0 | Human | Functional | pIC50 | = | 10.4 | 10.4 | -3 | 4 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9168941 | ||||
| 3898 | 2446 | None | 0 | Rat | Functional | pIC50 | = | 11 | 11.0 | 3 | 4 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9108306 | ||||
| 3898 | 2446 | None | 0 | Rat | Functional | pIC50 | = | 11 | 11.0 | 3 | 4 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9168941 | ||||
| 20549618 | 48 | None | 0 | Human | Functional | pIC50 | = | 5.6 | 5.6 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | 182 | 0 | 0 | 4 | -0.7 | O=S1(=O)CCS(=O)(=O)C=C1 | 10896115 | ||
| 3486 | 48 | None | 0 | Human | Functional | pIC50 | = | 5.6 | 5.6 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | 182 | 0 | 0 | 4 | -0.7 | O=S1(=O)CCS(=O)(=O)C=C1 | 10896115 | ||
| 155817474 | 1728 | None | 0 | Human | Functional | pIC50 | = | 6.1 | 6.1 | -489 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 11481429 | ||||
| 5357 | 1728 | None | 0 | Human | Functional | pIC50 | = | 6.1 | 6.1 | -489 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 11481429 | ||||
| 6124 | 1439 | None | 0 | Human | Functional | pIC50 | = | 6.7 | 6.7 | 158 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | 286 | 1 | 0 | 4 | 1.5 | Cc1ccc(cc1)C1=CS(=O)(=O)CCCS1(=O)=O | 10896115 | ||
| 9947811 | 1439 | None | 0 | Human | Functional | pIC50 | = | 6.7 | 6.7 | 158 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | 286 | 1 | 0 | 4 | 1.5 | Cc1ccc(cc1)C1=CS(=O)(=O)CCCS1(=O)=O | 10896115 | ||
| CHEMBL3906195 | 1439 | None | 0 | Human | Functional | pIC50 | = | 6.7 | 6.7 | 158 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | 286 | 1 | 0 | 4 | 1.5 | Cc1ccc(cc1)C1=CS(=O)(=O)CCCS1(=O)=O | 10896115 | ||
| 155817485 | 1757 | None | 0 | Human | Functional | pIC50 | = | 6.9 | 6.9 | -1 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 15944009 | ||||
| 6121 | 1757 | None | 0 | Human | Functional | pIC50 | = | 6.9 | 6.9 | -1 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 15944009 | ||||
| 3594 | 1742 | None | 0 | Human | Functional | pIC50 | = | 7.1 | 7.1 | -7 | 3 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 15944009 | ||||
| 3596 | 1740 | None | 0 | Rat | Functional | pIC50 | = | 7.4 | 7.4 | -29 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 20880399 | ||||
| 134813891 | 1758 | None | 0 | Human | Functional | pIC50 | = | 7.5 | 7.5 | -2 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 15944009 | ||||
| 6122 | 1758 | None | 0 | Human | Functional | pIC50 | = | 7.5 | 7.5 | -2 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 15944009 | ||||
| 155817487 | 1729 | None | 0 | Human | Functional | pIC50 | = | 7.5 | 7.5 | -9 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9685625 | ||||
| 6130 | 1729 | None | 0 | Human | Functional | pIC50 | = | 7.5 | 7.5 | -9 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9685625 | ||||
| 155817465 | 1730 | None | 0 | Human | Functional | pIC50 | = | 8 | 8.0 | -3 | 3 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9168941 | ||||
| 3876 | 1730 | None | 0 | Human | Functional | pIC50 | = | 8 | 8.0 | -3 | 3 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9168941 | ||||
| 155817465 | 1730 | None | 0 | Rat | Functional | pIC50 | = | 8.1 | 8.1 | -2 | 3 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9108306 | ||||
| 155817465 | 1730 | None | 0 | Rat | Functional | pIC50 | = | 8.1 | 8.1 | -2 | 3 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9168941 | ||||
| 3876 | 1730 | None | 0 | Rat | Functional | pIC50 | = | 8.1 | 8.1 | -2 | 3 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9108306 | ||||
| 3876 | 1730 | None | 0 | Rat | Functional | pIC50 | = | 8.1 | 8.1 | -2 | 3 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9168941 | ||||
| 155817463 | 777 | None | 0 | Rat | Functional | pIC50 | = | 8.3 | 8.3 | -1 | 4 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9108306 | ||||
Showing 1 to 50 of 138 entries
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
| 101927062 | 1716 | None | 20 | Human | Binding | pIC50 | = | 10.1 | 10.1 | -10 | 6 | Displacement of [125I]galanin from human recombinant GAL1 receptor expressed in HEK293 cells measured after 60 mins by scintillation counting methodDisplacement of [125I]galanin from human recombinant GAL1 receptor expressed in HEK293 cells measured after 60 mins by scintillation counting method |
ChEMBL | None | None | None | None | 10.1016/j.bmc.2016.11.014 | ||||
| 155817445 | 1716 | None | 20 | Human | Binding | pIC50 | = | 10.1 | 10.1 | -10 | 6 | Displacement of [125I]galanin from human recombinant GAL1 receptor expressed in HEK293 cells measured after 60 mins by scintillation counting methodDisplacement of [125I]galanin from human recombinant GAL1 receptor expressed in HEK293 cells measured after 60 mins by scintillation counting method |
ChEMBL | None | None | None | None | 10.1016/j.bmc.2016.11.014 | ||||
| 16133823 | 1716 | None | 20 | Human | Binding | pIC50 | = | 10.1 | 10.1 | -10 | 6 | Displacement of [125I]galanin from human recombinant GAL1 receptor expressed in HEK293 cells measured after 60 mins by scintillation counting methodDisplacement of [125I]galanin from human recombinant GAL1 receptor expressed in HEK293 cells measured after 60 mins by scintillation counting method |
ChEMBL | None | None | None | None | 10.1016/j.bmc.2016.11.014 | ||||
| 3592 | 1716 | None | 20 | Human | Binding | pIC50 | = | 10.1 | 10.1 | -10 | 6 | Displacement of [125I]galanin from human recombinant GAL1 receptor expressed in HEK293 cells measured after 60 mins by scintillation counting methodDisplacement of [125I]galanin from human recombinant GAL1 receptor expressed in HEK293 cells measured after 60 mins by scintillation counting method |
ChEMBL | None | None | None | None | 10.1016/j.bmc.2016.11.014 | ||||
| 44584852 | 1716 | None | 20 | Human | Binding | pIC50 | = | 10.1 | 10.1 | -10 | 6 | Displacement of [125I]galanin from human recombinant GAL1 receptor expressed in HEK293 cells measured after 60 mins by scintillation counting methodDisplacement of [125I]galanin from human recombinant GAL1 receptor expressed in HEK293 cells measured after 60 mins by scintillation counting method |
ChEMBL | None | None | None | None | 10.1016/j.bmc.2016.11.014 | ||||
| 6090 | 1716 | None | 20 | Human | Binding | pIC50 | = | 10.1 | 10.1 | -10 | 6 | Displacement of [125I]galanin from human recombinant GAL1 receptor expressed in HEK293 cells measured after 60 mins by scintillation counting methodDisplacement of [125I]galanin from human recombinant GAL1 receptor expressed in HEK293 cells measured after 60 mins by scintillation counting method |
ChEMBL | None | None | None | None | 10.1016/j.bmc.2016.11.014 | ||||
| 91898917 | 1716 | None | 20 | Human | Binding | pIC50 | = | 10.1 | 10.1 | -10 | 6 | Displacement of [125I]galanin from human recombinant GAL1 receptor expressed in HEK293 cells measured after 60 mins by scintillation counting methodDisplacement of [125I]galanin from human recombinant GAL1 receptor expressed in HEK293 cells measured after 60 mins by scintillation counting method |
ChEMBL | None | None | None | None | 10.1016/j.bmc.2016.11.014 | ||||
| CHEMBL506553 | 1716 | None | 20 | Human | Binding | pIC50 | = | 10.1 | 10.1 | -10 | 6 | Displacement of [125I]galanin from human recombinant GAL1 receptor expressed in HEK293 cells measured after 60 mins by scintillation counting methodDisplacement of [125I]galanin from human recombinant GAL1 receptor expressed in HEK293 cells measured after 60 mins by scintillation counting method |
ChEMBL | None | None | None | None | 10.1016/j.bmc.2016.11.014 | ||||
| CHEMBL501079 | 216618 | None | 9 | Human | Binding | pIC50 | = | 9.8 | 9.8 | 11 | 2 | Binding affinity to human GAL1 receptor by radioligand displacement assayBinding affinity to human GAL1 receptor by radioligand displacement assay |
ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CN)[C@@H](C)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(N)=O | 10.1016/j.bmc.2013.03.016 | ||||
| CHEMBL501079 | 216618 | None | 9 | Human | Binding | pIC50 | = | 9.1 | 9.1 | 11 | 2 | Binding affinity to human GAL1 receptor by radioligand displacement assayBinding affinity to human GAL1 receptor by radioligand displacement assay |
ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CN)[C@@H](C)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(N)=O | 10.1016/j.ejmech.2013.01.044 | ||||
| CHEMBL501079 | 216618 | None | 9 | Human | Binding | pIC50 | = | 9.1 | 9.1 | 11 | 2 | Displacement of radiolabeled galanin from human galanin 1 receptorDisplacement of radiolabeled galanin from human galanin 1 receptor |
ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CN)[C@@H](C)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(N)=O | 10.1021/jm8007618 | ||||
| CHEMBL473840 | 216514 | None | 0 | Rat | Binding | pIC50 | = | 8.0 | 8.0 | - | 0 | Inhibition of [3H]glycine uptake at rat glycine transporter 1 expressed in african green monkey COS7 cellsInhibition of [3H]glycine uptake at rat glycine transporter 1 expressed in african green monkey COS7 cells |
ChEMBL | None | None | None | CC[C@H](C)[C@@H]1NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H]([C@H](C)[C@@H](C)O)NC(=O)[C@H](C(C)C)NC1=O | 10.1016/j.bmcl.2008.10.104 | ||||
| 134142691 | 145784 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 344 | 3 | 0 | 6 | 1.4 | CCOC(=O)c1cccc(C2=CS(=O)(=O)CCCS2(=O)=O)c1 | nan | ||
| CHEMBL3916206 | 145784 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 344 | 3 | 0 | 6 | 1.4 | CCOC(=O)c1cccc(C2=CS(=O)(=O)CCCS2(=O)=O)c1 | nan | ||
| 101061658 | 148670 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 302 | 2 | 0 | 5 | 1.2 | COc1ccccc1C1=CS(=O)(=O)CCCS1(=O)=O | nan | ||
| CHEMBL3939021 | 148670 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 302 | 2 | 0 | 5 | 1.2 | COc1ccccc1C1=CS(=O)(=O)CCCS1(=O)=O | nan | ||
| 12043584 | 150886 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 336 | 1 | 0 | 4 | 1.6 | O=S1(=O)C=C(c2ccc(Br)cc2)S(=O)(=O)CC1 | nan | ||
| CHEMBL3956728 | 150886 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 336 | 1 | 0 | 4 | 1.6 | O=S1(=O)C=C(c2ccc(Br)cc2)S(=O)(=O)CC1 | nan | ||
| 134155181 | 151479 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 477 | 9 | 1 | 6 | 2.9 | CCCCOc1ccccc1C(=O)NC(Cc1ccccc1)C1=CS(=O)(=O)CCS1(=O)=O | nan | ||
| CHEMBL3961540 | 151479 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 477 | 9 | 1 | 6 | 2.9 | CCCCOc1ccccc1C(=O)NC(Cc1ccccc1)C1=CS(=O)(=O)CCS1(=O)=O | nan | ||
| 9861375 | 153346 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 306 | 1 | 0 | 4 | 1.9 | O=S1(=O)C=C(c2cccc(Cl)c2)S(=O)(=O)CCC1 | nan | ||
| CHEMBL3977579 | 153346 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 306 | 1 | 0 | 4 | 1.9 | O=S1(=O)C=C(c2cccc(Cl)c2)S(=O)(=O)CCC1 | nan | ||
| 90721869 | 150436 | None | 0 | Human | Binding | pIC50 | = | 6.0 | 6.0 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 357 | 4 | 1 | 5 | 1.4 | CCCNC(=O)c1ccc(C2=CS(=O)(=O)CCCS2(=O)=O)cc1 | nan | ||
| CHEMBL3953131 | 150436 | None | 0 | Human | Binding | pIC50 | = | 6.0 | 6.0 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 357 | 4 | 1 | 5 | 1.4 | CCCNC(=O)c1ccc(C2=CS(=O)(=O)CCCS2(=O)=O)cc1 | nan | ||
| 134142161 | 145671 | None | 0 | Human | Binding | pIC50 | = | 6.0 | 6.0 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 419 | 5 | 1 | 5 | 2.2 | O=C(NCCc1ccccc1)c1ccc(C2=CS(=O)(=O)CCCS2(=O)=O)cc1 | nan | ||
| CHEMBL3915361 | 145671 | None | 0 | Human | Binding | pIC50 | = | 6.0 | 6.0 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 419 | 5 | 1 | 5 | 2.2 | O=C(NCCc1ccccc1)c1ccc(C2=CS(=O)(=O)CCCS2(=O)=O)cc1 | nan | ||
| CHEMBL474038 | 216516 | None | 0 | Rat | Binding | pIC50 | = | 8.0 | 8.0 | - | 0 | Inhibition of [3H]glycine uptake at rat glycine transporter 1 expressed in african green monkey COS7 cellsInhibition of [3H]glycine uptake at rat glycine transporter 1 expressed in african green monkey COS7 cells |
ChEMBL | None | None | None | CC(C)[C@@H]1NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H]([C@H](C)[C@@H](C)O)NC(=O)[C@H](C(C)C)NC1=O | 10.1016/j.bmcl.2008.10.104 | ||||
| CHEMBL474037 | 216515 | None | 0 | Rat | Binding | pIC50 | = | 7.9 | 7.9 | - | 0 | Inhibition of [3H]glycine uptake at rat glycine transporter 1 expressed in african green monkey COS7 cellsInhibition of [3H]glycine uptake at rat glycine transporter 1 expressed in african green monkey COS7 cells |
ChEMBL | None | None | None | CC[C@H](C)[C@@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H]([C@H](C)[C@@H](C)O)NC1=O | 10.1016/j.bmcl.2008.10.104 | ||||
| 91480105 | 153622 | None | 0 | Human | Binding | pIC50 | = | 6.0 | 6.0 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 354 | 2 | 0 | 4 | 3.3 | O=S1(=O)C=C(c2ccc(C3CCCCC3)cc2)S(=O)(=O)CCC1 | nan | ||
| CHEMBL3980007 | 153622 | None | 0 | Human | Binding | pIC50 | = | 6.0 | 6.0 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 354 | 2 | 0 | 4 | 3.3 | O=S1(=O)C=C(c2ccc(C3CCCCC3)cc2)S(=O)(=O)CCC1 | nan | ||
| 57399456 | 68821 | None | 0 | Human | Binding | pIC50 | = | 4.9 | 4.9 | - | 0 | Displacement of [125I]galanin from GalR1 by gamma countingDisplacement of [125I]galanin from GalR1 by gamma counting |
ChEMBL | 430 | 6 | 1 | 7 | 4.2 | COc1ccc(Nc2cc(N3CCN(c4ccccc4)CC3)nc(N3CCCC3)n2)cc1 | 10.1016/j.bmcl.2011.09.033 | ||
| CHEMBL1921992 | 68821 | None | 0 | Human | Binding | pIC50 | = | 4.9 | 4.9 | - | 0 | Displacement of [125I]galanin from GalR1 by gamma countingDisplacement of [125I]galanin from GalR1 by gamma counting |
ChEMBL | 430 | 6 | 1 | 7 | 4.2 | COc1ccc(Nc2cc(N3CCN(c4ccccc4)CC3)nc(N3CCCC3)n2)cc1 | 10.1016/j.bmcl.2011.09.033 | ||
| 57394238 | 68833 | None | 0 | Human | Binding | pIC50 | = | 5.9 | 5.9 | - | 0 | Displacement of [125I]galanin from GalR1 by gamma countingDisplacement of [125I]galanin from GalR1 by gamma counting |
ChEMBL | 529 | 5 | 1 | 7 | 5.8 | Cc1c(F)cccc1Nc1cc(N2CCCCC2)nc(N2CCCN(c3ncccc3C(F)(F)F)CC2)n1 | 10.1016/j.bmcl.2011.09.033 | ||
| CHEMBL1922003 | 68833 | None | 0 | Human | Binding | pIC50 | = | 5.9 | 5.9 | - | 0 | Displacement of [125I]galanin from GalR1 by gamma countingDisplacement of [125I]galanin from GalR1 by gamma counting |
ChEMBL | 529 | 5 | 1 | 7 | 5.8 | Cc1c(F)cccc1Nc1cc(N2CCCCC2)nc(N2CCCN(c3ncccc3C(F)(F)F)CC2)n1 | 10.1016/j.bmcl.2011.09.033 | ||
| 9925905 | 145035 | None | 0 | Human | Binding | pIC50 | = | 5.9 | 5.9 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 286 | 1 | 0 | 4 | 1.5 | Cc1cccc(C2=CS(=O)(=O)CCCS2(=O)=O)c1 | nan | ||
| CHEMBL3910434 | 145035 | None | 0 | Human | Binding | pIC50 | = | 5.9 | 5.9 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 286 | 1 | 0 | 4 | 1.5 | Cc1cccc(C2=CS(=O)(=O)CCCS2(=O)=O)c1 | nan | ||
| 9796013 | 146050 | None | 0 | Human | Binding | pIC50 | = | 5.9 | 5.9 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 290 | 1 | 0 | 4 | 1.4 | O=S1(=O)C=C(c2cccc(F)c2)S(=O)(=O)CCC1 | nan | ||
| CHEMBL3918185 | 146050 | None | 0 | Human | Binding | pIC50 | = | 5.9 | 5.9 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 290 | 1 | 0 | 4 | 1.4 | O=S1(=O)C=C(c2cccc(F)c2)S(=O)(=O)CCC1 | nan | ||
| 57008825 | 152917 | None | 0 | Human | Binding | pIC50 | = | 5.9 | 5.9 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 278 | 1 | 0 | 5 | 1.3 | O=S1(=O)C=C(c2cccs2)S(=O)(=O)CCC1 | nan | ||
| CHEMBL3973948 | 152917 | None | 0 | Human | Binding | pIC50 | = | 5.9 | 5.9 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 278 | 1 | 0 | 5 | 1.3 | O=S1(=O)C=C(c2cccs2)S(=O)(=O)CCC1 | nan | ||
| 101061657 | 153207 | None | 0 | Human | Binding | pIC50 | = | 5.9 | 5.9 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 278 | 1 | 0 | 5 | 1.3 | O=S1(=O)C=C(c2ccsc2)S(=O)(=O)CCC1 | nan | ||
| CHEMBL3976401 | 153207 | None | 0 | Human | Binding | pIC50 | = | 5.9 | 5.9 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 278 | 1 | 0 | 5 | 1.3 | O=S1(=O)C=C(c2ccsc2)S(=O)(=O)CCC1 | nan | ||
| 91376438 | 144206 | None | 0 | Human | Binding | pIC50 | = | 5.8 | 5.8 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 412 | 3 | 0 | 6 | 2.1 | O=S1(=O)C=C(c2ccc(S(=O)(=O)c3ccccc3)cc2)S(=O)(=O)CCC1 | nan | ||
| CHEMBL3903668 | 144206 | None | 0 | Human | Binding | pIC50 | = | 5.8 | 5.8 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 412 | 3 | 0 | 6 | 2.1 | O=S1(=O)C=C(c2ccc(S(=O)(=O)c3ccccc3)cc2)S(=O)(=O)CCC1 | nan | ||
| 91000662 | 150767 | None | 0 | Human | Binding | pIC50 | = | 5.8 | 5.8 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 286 | 1 | 0 | 4 | 1.5 | Cc1ccccc1C1=CS(=O)(=O)CCCS1(=O)=O | nan | ||
| CHEMBL3955804 | 150767 | None | 0 | Human | Binding | pIC50 | = | 5.8 | 5.8 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 286 | 1 | 0 | 4 | 1.5 | Cc1ccccc1C1=CS(=O)(=O)CCCS1(=O)=O | nan | ||
| 57401227 | 68851 | None | 0 | Human | Binding | pIC50 | = | 4.8 | 4.8 | - | 0 | Displacement of [125I]galanin from GalR1 by gamma countingDisplacement of [125I]galanin from GalR1 by gamma counting |
ChEMBL | 506 | 8 | 2 | 8 | 5.6 | COc1ccc(Nc2nc(Nc3ccc(OC)c(F)c3)cc(N3CCC(N4CCCCC4)CC3)n2)cc1 | 10.1016/j.bmcl.2011.09.033 | ||
| CHEMBL1922024 | 68851 | None | 0 | Human | Binding | pIC50 | = | 4.8 | 4.8 | - | 0 | Displacement of [125I]galanin from GalR1 by gamma countingDisplacement of [125I]galanin from GalR1 by gamma counting |
ChEMBL | 506 | 8 | 2 | 8 | 5.6 | COc1ccc(Nc2nc(Nc3ccc(OC)c(F)c3)cc(N3CCC(N4CCCCC4)CC3)n2)cc1 | 10.1016/j.bmcl.2011.09.033 | ||
| 6124 | 1439 | None | 0 | Human | Binding | pIC50 | = | 6.7 | 6.7 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 286 | 1 | 0 | 4 | 1.5 | Cc1ccc(cc1)C1=CS(=O)(=O)CCCS1(=O)=O | nan | ||
| 9947811 | 1439 | None | 0 | Human | Binding | pIC50 | = | 6.7 | 6.7 | - | 0 | Displacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assayDisplacement of [125I]human galanin from human galanin-1 receptor after 16 hrs by scintillation proximity assay |
ChEMBL | 286 | 1 | 0 | 4 | 1.5 | Cc1ccc(cc1)C1=CS(=O)(=O)CCCS1(=O)=O | nan | ||
Showing 1 to 50 of 560 entries