Ligand source activities (1 row/activity)
Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| #Vendors | Reference ligand
| Fold selectivity | # Tested GPCRs | Species
| p-value (-log) | Activity Type
| Activity Relation
| Activity Value
| AssayType
| Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
|
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Assay information
| Chemical information
| ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| #Vendors | Reference ligand
| Fold selectivity | # Tested GPCRs | Species
| p-value (-log) | Activity Type
| Activity Relation
| Activity Value
| AssayType
| Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
|
101635584 | 2596 | 31 | None | - | 1 | Human | 10.4 | pEC50 | = | 10.4 | Functional | Agonist activity at human recombinant motilin receptor expressed in CHO cells assessed as increase in intracellular calcium by FLIPR assayAgonist activity at human recombinant motilin receptor expressed in CHO cells assessed as increase in intracellular calcium by FLIPR assay |
ChEMBL | None | None | None | None | 10.1021/jm801332q | |||
1458 | 2596 | 31 | None | - | 1 | Human | 10.4 | pEC50 | = | 10.4 | Functional | Agonist activity at human recombinant motilin receptor expressed in CHO cells assessed as increase in intracellular calcium by FLIPR assayAgonist activity at human recombinant motilin receptor expressed in CHO cells assessed as increase in intracellular calcium by FLIPR assay |
ChEMBL | None | None | None | None | 10.1021/jm801332q | |||
16136567 | 2596 | 31 | None | - | 1 | Human | 10.4 | pEC50 | = | 10.4 | Functional | Agonist activity at human recombinant motilin receptor expressed in CHO cells assessed as increase in intracellular calcium by FLIPR assayAgonist activity at human recombinant motilin receptor expressed in CHO cells assessed as increase in intracellular calcium by FLIPR assay |
ChEMBL | None | None | None | None | 10.1021/jm801332q | |||
3794 | 2596 | 31 | None | - | 1 | Human | 10.4 | pEC50 | = | 10.4 | Functional | Agonist activity at human recombinant motilin receptor expressed in CHO cells assessed as increase in intracellular calcium by FLIPR assayAgonist activity at human recombinant motilin receptor expressed in CHO cells assessed as increase in intracellular calcium by FLIPR assay |
ChEMBL | None | None | None | None | 10.1021/jm801332q | |||
91898963 | 2596 | 31 | None | - | 1 | Human | 10.4 | pEC50 | = | 10.4 | Functional | Agonist activity at human recombinant motilin receptor expressed in CHO cells assessed as increase in intracellular calcium by FLIPR assayAgonist activity at human recombinant motilin receptor expressed in CHO cells assessed as increase in intracellular calcium by FLIPR assay |
ChEMBL | None | None | None | None | 10.1021/jm801332q | |||
CHEMBL525634 | 2596 | 31 | None | - | 1 | Human | 10.4 | pEC50 | = | 10.4 | Functional | Agonist activity at human recombinant motilin receptor expressed in CHO cells assessed as increase in intracellular calcium by FLIPR assayAgonist activity at human recombinant motilin receptor expressed in CHO cells assessed as increase in intracellular calcium by FLIPR assay |
ChEMBL | None | None | None | None | 10.1021/jm801332q | |||
10010118 | 101435 | 0 | None | - | 1 | Human | 10.3 | pEC50 | = | 10.3 | Functional | In vitro effective concentration towards human motilin receptorIn vitro effective concentration towards human motilin receptor |
ChEMBL | 723 | 13 | 4 | 11 | 1.7 | NC(=O)[C@H](CCc1ccccc1)NC(=O)[C@H](CCc1ccccc1)NC(=O)C1CCC2(CCNCC2)n2c(=O)n(Cc3ccc4c(c3)OCO4)c(=O)n21 | 10.1021/jm0304865 | |
CHEMBL297494 | 101435 | 0 | None | - | 1 | Human | 10.3 | pEC50 | = | 10.3 | Functional | In vitro effective concentration towards human motilin receptorIn vitro effective concentration towards human motilin receptor |
ChEMBL | 723 | 13 | 4 | 11 | 1.7 | NC(=O)[C@H](CCc1ccccc1)NC(=O)[C@H](CCc1ccccc1)NC(=O)C1CCC2(CCNCC2)n2c(=O)n(Cc3ccc4c(c3)OCO4)c(=O)n21 | 10.1021/jm0304865 | |
CHEMBL2372767 | 210285 | 0 | None | - | 1 | Human | 9.8 | pEC50 | = | 9.8 | Functional | In vitro effective concentration towards human motilin receptorIn vitro effective concentration towards human motilin receptor |
ChEMBL | None | None | None | CC[C@H](C)[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)[C@@H](N)Cc1ccccc1)C(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NCC(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@H](CCSC)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)O)[C@@H](C)O | 10.1021/jm0304865 | |||
11181688 | 101335 | 0 | None | - | 1 | Human | 9.7 | pEC50 | = | 9.7 | Functional | In vitro effective concentration towards human motilin receptorIn vitro effective concentration towards human motilin receptor |
ChEMBL | 721 | 13 | 4 | 11 | 1.5 | NC(=O)[C@H](CCc1ccccc1)NC(=O)[C@H](CCc1ccccc1)NC(=O)C1C=CC2(CCNCC2)n2c(=O)n(Cc3ccc4c(c3)OCO4)c(=O)n21 | 10.1021/jm0304865 | |
CHEMBL296748 | 101335 | 0 | None | - | 1 | Human | 9.7 | pEC50 | = | 9.7 | Functional | In vitro effective concentration towards human motilin receptorIn vitro effective concentration towards human motilin receptor |
ChEMBL | 721 | 13 | 4 | 11 | 1.5 | NC(=O)[C@H](CCc1ccccc1)NC(=O)[C@H](CCc1ccccc1)NC(=O)C1C=CC2(CCNCC2)n2c(=O)n(Cc3ccc4c(c3)OCO4)c(=O)n21 | 10.1021/jm0304865 | |
23728661 | 88830 | 0 | None | - | 1 | Human | 9.6 | pEC50 | = | 9.6 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 432 | 5 | 1 | 4 | 4.3 | Cc1cc(N(C)C(=O)c2ccc(-c3cccc(F)c3)nc2)ccc1CN1CCN[C@@H](C)C1 | 10.6019/CHEMBL2364262 | |
CHEMBL2364292 | 88830 | 0 | None | - | 1 | Human | 9.6 | pEC50 | = | 9.6 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 432 | 5 | 1 | 4 | 4.3 | Cc1cc(N(C)C(=O)c2ccc(-c3cccc(F)c3)nc2)ccc1CN1CCN[C@@H](C)C1 | 10.6019/CHEMBL2364262 | |
23728772 | 88851 | 0 | None | - | 1 | Human | 9.6 | pEC50 | = | 9.6 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 448 | 6 | 1 | 5 | 4.4 | Cc1cc(N(C)C(=O)c2ccc(Oc3ccc(F)cc3)nc2)ccc1CN1CCN[C@@H](C)C1 | 10.6019/CHEMBL2364262 | |
CHEMBL2364312 | 88851 | 0 | None | - | 1 | Human | 9.6 | pEC50 | = | 9.6 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 448 | 6 | 1 | 5 | 4.4 | Cc1cc(N(C)C(=O)c2ccc(Oc3ccc(F)cc3)nc2)ccc1CN1CCN[C@@H](C)C1 | 10.6019/CHEMBL2364262 | |
23728875 | 88856 | 0 | None | - | 1 | Human | 9.5 | pEC50 | = | 9.5 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 468 | 6 | 1 | 5 | 4.7 | C[C@H]1CN(Cc2ccc(N(C)C(=O)c3ccc(Oc4ccc(F)cc4)nc3)cc2Cl)CCN1 | 10.6019/CHEMBL2364262 | |
CHEMBL2364317 | 88856 | 0 | None | - | 1 | Human | 9.5 | pEC50 | = | 9.5 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 468 | 6 | 1 | 5 | 4.7 | C[C@H]1CN(Cc2ccc(N(C)C(=O)c3ccc(Oc4ccc(F)cc4)nc3)cc2Cl)CCN1 | 10.6019/CHEMBL2364262 | |
10010118 | 101435 | 0 | None | - | 1 | Human | 9.5 | pEC50 | = | 9.5 | Functional | In vitro effective concentration towards human motilin receptorIn vitro effective concentration towards human motilin receptor |
ChEMBL | 723 | 13 | 4 | 11 | 1.7 | NC(=O)[C@H](CCc1ccccc1)NC(=O)[C@H](CCc1ccccc1)NC(=O)C1CCC2(CCNCC2)n2c(=O)n(Cc3ccc4c(c3)OCO4)c(=O)n21 | 10.1021/jm0304865 | |
CHEMBL297494 | 101435 | 0 | None | - | 1 | Human | 9.5 | pEC50 | = | 9.5 | Functional | In vitro effective concentration towards human motilin receptorIn vitro effective concentration towards human motilin receptor |
ChEMBL | 723 | 13 | 4 | 11 | 1.7 | NC(=O)[C@H](CCc1ccccc1)NC(=O)[C@H](CCc1ccccc1)NC(=O)C1CCC2(CCNCC2)n2c(=O)n(Cc3ccc4c(c3)OCO4)c(=O)n21 | 10.1021/jm0304865 | |
23728544 | 88823 | 0 | None | - | 1 | Human | 9.4 | pEC50 | = | 9.4 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 446 | 5 | 1 | 4 | 4.7 | Cc1nc(-c2ccc(F)cc2)ccc1C(=O)N(C)c1ccc(CN2C[C@H](C)N[C@H](C)C2)cc1 | 10.6019/CHEMBL2364262 | |
CHEMBL2364285 | 88823 | 0 | None | - | 1 | Human | 9.4 | pEC50 | = | 9.4 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 446 | 5 | 1 | 4 | 4.7 | Cc1nc(-c2ccc(F)cc2)ccc1C(=O)N(C)c1ccc(CN2C[C@H](C)N[C@H](C)C2)cc1 | 10.6019/CHEMBL2364262 | |
23728806 | 88857 | 0 | None | - | 1 | Human | 9.4 | pEC50 | = | 9.4 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 448 | 7 | 1 | 5 | 4.5 | CCN(C(=O)c1ccc(Oc2ccc(F)cc2)nc1)c1ccc(CN2CCN[C@@H](C)C2)cc1 | 10.6019/CHEMBL2364262 | |
CHEMBL2364318 | 88857 | 0 | None | - | 1 | Human | 9.4 | pEC50 | = | 9.4 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 448 | 7 | 1 | 5 | 4.5 | CCN(C(=O)c1ccc(Oc2ccc(F)cc2)nc1)c1ccc(CN2CCN[C@@H](C)C2)cc1 | 10.6019/CHEMBL2364262 | |
23729106 | 88820 | 0 | None | - | 1 | Human | 9.2 | pEC50 | = | 9.2 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 432 | 5 | 1 | 4 | 4.3 | Cc1nc(-c2cccc(F)c2)ccc1C(=O)N(C)c1ccc(CN2CCN[C@@H](C)C2)cc1 | 10.6019/CHEMBL2364262 | |
CHEMBL2364282 | 88820 | 0 | None | - | 1 | Human | 9.2 | pEC50 | = | 9.2 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 432 | 5 | 1 | 4 | 4.3 | Cc1nc(-c2cccc(F)c2)ccc1C(=O)N(C)c1ccc(CN2CCN[C@@H](C)C2)cc1 | 10.6019/CHEMBL2364262 | |
23728770 | 88840 | 0 | None | - | 1 | Human | 9.1 | pEC50 | = | 9.1 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 432 | 6 | 1 | 4 | 4.3 | CCN(C(=O)c1ccc(-c2cccc(F)c2)nc1)c1ccc(CN2CCN[C@@H](C)C2)cc1 | 10.6019/CHEMBL2364262 | |
CHEMBL2364302 | 88840 | 0 | None | - | 1 | Human | 9.1 | pEC50 | = | 9.1 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 432 | 6 | 1 | 4 | 4.3 | CCN(C(=O)c1ccc(-c2cccc(F)c2)nc1)c1ccc(CN2CCN[C@@H](C)C2)cc1 | 10.6019/CHEMBL2364262 | |
16749783 | 88869 | 0 | None | - | 1 | Human | 9.1 | pEC50 | = | 9.1 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 450 | 6 | 1 | 7 | 3.2 | C[C@H]1CN(Cc2ccn(-c3cccnc3N3CCC(Oc4cccc(F)c4)CC3)n2)CCN1 | 10.6019/CHEMBL2364262 | |
CHEMBL2364330 | 88869 | 0 | None | - | 1 | Human | 9.1 | pEC50 | = | 9.1 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 450 | 6 | 1 | 7 | 3.2 | C[C@H]1CN(Cc2ccn(-c3cccnc3N3CCC(Oc4cccc(F)c4)CC3)n2)CCN1 | 10.6019/CHEMBL2364262 | |
101635584 | 2596 | 31 | None | - | 1 | Human | 9.0 | pEC50 | = | 9.0 | Functional | Agonist activity at human GPR38 expressed in COS-7 cellsAgonist activity at human GPR38 expressed in COS-7 cells |
ChEMBL | None | None | None | None | 10.1016/j.bmcl.2022.128554 | |||
1458 | 2596 | 31 | None | - | 1 | Human | 9.0 | pEC50 | = | 9.0 | Functional | Agonist activity at human GPR38 expressed in COS-7 cellsAgonist activity at human GPR38 expressed in COS-7 cells |
ChEMBL | None | None | None | None | 10.1016/j.bmcl.2022.128554 | |||
16136567 | 2596 | 31 | None | - | 1 | Human | 9.0 | pEC50 | = | 9.0 | Functional | Agonist activity at human GPR38 expressed in COS-7 cellsAgonist activity at human GPR38 expressed in COS-7 cells |
ChEMBL | None | None | None | None | 10.1016/j.bmcl.2022.128554 | |||
3794 | 2596 | 31 | None | - | 1 | Human | 9.0 | pEC50 | = | 9.0 | Functional | Agonist activity at human GPR38 expressed in COS-7 cellsAgonist activity at human GPR38 expressed in COS-7 cells |
ChEMBL | None | None | None | None | 10.1016/j.bmcl.2022.128554 | |||
91898963 | 2596 | 31 | None | - | 1 | Human | 9.0 | pEC50 | = | 9.0 | Functional | Agonist activity at human GPR38 expressed in COS-7 cellsAgonist activity at human GPR38 expressed in COS-7 cells |
ChEMBL | None | None | None | None | 10.1016/j.bmcl.2022.128554 | |||
CHEMBL525634 | 2596 | 31 | None | - | 1 | Human | 9.0 | pEC50 | = | 9.0 | Functional | Agonist activity at human GPR38 expressed in COS-7 cellsAgonist activity at human GPR38 expressed in COS-7 cells |
ChEMBL | None | None | None | None | 10.1016/j.bmcl.2022.128554 | |||
23728693 | 88835 | 0 | None | - | 1 | Human | 9.0 | pEC50 | = | 9 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 434 | 6 | 1 | 5 | 4.1 | C[C@H]1CN(Cc2ccc(N(C)C(=O)c3ccc(Oc4cccc(F)c4)cn3)cc2)CCN1 | 10.6019/CHEMBL2364262 | |
CHEMBL2364297 | 88835 | 0 | None | - | 1 | Human | 9.0 | pEC50 | = | 9 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 434 | 6 | 1 | 5 | 4.1 | C[C@H]1CN(Cc2ccc(N(C)C(=O)c3ccc(Oc4cccc(F)c4)cn3)cc2)CCN1 | 10.6019/CHEMBL2364262 | |
16040758 | 88865 | 0 | None | - | 1 | Human | 9.0 | pEC50 | = | 9 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 487 | 6 | 2 | 5 | 4.4 | C[C@H]1CN(Cc2ccc(-c3cccnc3C(=O)N3CCC(Nc4ccc(F)cc4)CC3)cc2)CCN1 | 10.6019/CHEMBL2364262 | |
CHEMBL2364326 | 88865 | 0 | None | - | 1 | Human | 9.0 | pEC50 | = | 9 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 487 | 6 | 2 | 5 | 4.4 | C[C@H]1CN(Cc2ccc(-c3cccnc3C(=O)N3CCC(Nc4ccc(F)cc4)CC3)cc2)CCN1 | 10.6019/CHEMBL2364262 | |
23729022 | 88819 | 0 | None | - | 1 | Human | 8.9 | pEC50 | = | 8.9 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 418 | 5 | 1 | 4 | 4.0 | C[C@H]1CN(Cc2ccc(N(C)C(=O)c3ccc(-c4cccc(F)c4)nc3)cc2)CCN1 | 10.6019/CHEMBL2364262 | |
CHEMBL2364281 | 88819 | 0 | None | - | 1 | Human | 8.9 | pEC50 | = | 8.9 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 418 | 5 | 1 | 4 | 4.0 | C[C@H]1CN(Cc2ccc(N(C)C(=O)c3ccc(-c4cccc(F)c4)nc3)cc2)CCN1 | 10.6019/CHEMBL2364262 | |
23728731 | 88839 | 0 | None | - | 1 | Human | 8.9 | pEC50 | = | 8.9 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 436 | 5 | 1 | 4 | 4.1 | C[C@H]1CN(Cc2ccc(N(C)C(=O)c3ccc(-c4cccc(F)c4)nc3)cc2F)CCN1 | 10.6019/CHEMBL2364262 | |
CHEMBL2364301 | 88839 | 0 | None | - | 1 | Human | 8.9 | pEC50 | = | 8.9 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 436 | 5 | 1 | 4 | 4.1 | C[C@H]1CN(Cc2ccc(N(C)C(=O)c3ccc(-c4cccc(F)c4)nc3)cc2F)CCN1 | 10.6019/CHEMBL2364262 | |
16749753 | 88868 | 0 | None | - | 1 | Human | 8.9 | pEC50 | = | 8.9 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 464 | 6 | 1 | 7 | 3.6 | C[C@H]1CN(Cc2ccn(-c3cccnc3N3CCC(Oc4ccc(F)cc4)CC3)n2)C[C@@H](C)N1 | 10.6019/CHEMBL2364262 | |
CHEMBL2364329 | 88868 | 0 | None | - | 1 | Human | 8.9 | pEC50 | = | 8.9 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 464 | 6 | 1 | 7 | 3.6 | C[C@H]1CN(Cc2ccn(-c3cccnc3N3CCC(Oc4ccc(F)cc4)CC3)n2)C[C@@H](C)N1 | 10.6019/CHEMBL2364262 | |
23729025 | 88815 | 0 | None | - | 1 | Human | 8.8 | pEC50 | = | 8.8 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 418 | 5 | 1 | 4 | 4.0 | C[C@H]1CN(Cc2ccc(N(C)C(=O)c3ccc(-c4ccc(F)cc4)nc3)cc2)CCN1 | 10.6019/CHEMBL2364262 | |
CHEMBL2364277 | 88815 | 0 | None | - | 1 | Human | 8.8 | pEC50 | = | 8.8 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 418 | 5 | 1 | 4 | 4.0 | C[C@H]1CN(Cc2ccc(N(C)C(=O)c3ccc(-c4ccc(F)cc4)nc3)cc2)CCN1 | 10.6019/CHEMBL2364262 | |
23728541 | 88822 | 0 | None | - | 1 | Human | 8.8 | pEC50 | = | 8.8 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 439 | 5 | 1 | 5 | 4.0 | Cc1nc(-c2cccc(C#N)c2)ccc1C(=O)N(C)c1ccc(CN2CCN[C@@H](C)C2)cc1 | 10.6019/CHEMBL2364262 | |
CHEMBL2364284 | 88822 | 0 | None | - | 1 | Human | 8.8 | pEC50 | = | 8.8 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 439 | 5 | 1 | 5 | 4.0 | Cc1nc(-c2cccc(C#N)c2)ccc1C(=O)N(C)c1ccc(CN2CCN[C@@H](C)C2)cc1 | 10.6019/CHEMBL2364262 | |
23728581 | 88826 | 0 | None | - | 1 | Human | 8.8 | pEC50 | = | 8.8 | Functional | SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680SUPPLEMENTARY: Agonist activity at human recombinant motilin receptor expressed in CHO cells by calcium mobilization-based FLIPR assay. Same assay as CHEMBL942680 |
ChEMBL | 433 | 5 | 1 | 5 | 3.7 | Cc1nc(-c2ccc(F)cc2)ncc1C(=O)N(C)c1ccc(CN2CCN[C@@H](C)C2)cc1 | 10.6019/CHEMBL2364262 |
Showing 1 to 50 of 745 entries
Ligands (move mouse cursor over ligand name to see structure) | Receptor | Assay information | Chemical information | |||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Similar- ity
| Common name
| GPCRdb ID | #Vendors
| Reference ligand | Fold selectivity | # Tested GPCRs
| Species | p-value (-log)
| Activity Type
| Activity Relation
| Activity Value
| Assay Type
| Assay Description
| Source | Mol weight | Rot Bonds | H don | H acc | LogP
| Smiles
| DOI |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Assay information
| Chemical information
| |||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Similar- ity
| Common name
| GPCRdb ID | #Vendors
| Reference ligand | Fold selectivity | # Tested GPCRs
| Species | p-value (-log)
| Activity Type
| Activity Relation
| Activity Value
| Assay Type
| Assay Description
| Source | Mol weight | Rot Bonds | H don | H acc | LogP
| Smiles
| DOI |
103 | 4153 | 61 | None | - | 53 | Human | 5.0 | pAC50 | = | 5.0 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 331 | 4 | 0 | 3 | 4.9 | CN(CCOC1=Cc2ccccc2Sc2c1cc(Cl)cc2)C | 10.1038/s41467-023-40064-9 | ||
2875 | 4153 | 61 | None | - | 53 | Human | 5.0 | pAC50 | = | 5.0 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 331 | 4 | 0 | 3 | 4.9 | CN(CCOC1=Cc2ccccc2Sc2c1cc(Cl)cc2)C | 10.1038/s41467-023-40064-9 | ||
5736 | 4153 | 61 | None | - | 53 | Human | 5.0 | pAC50 | = | 5.0 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 331 | 4 | 0 | 3 | 4.9 | CN(CCOC1=Cc2ccccc2Sc2c1cc(Cl)cc2)C | 10.1038/s41467-023-40064-9 | ||
CHEMBL285802 | 4153 | 61 | None | - | 53 | Human | 5.0 | pAC50 | = | 5.0 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 331 | 4 | 0 | 3 | 4.9 | CN(CCOC1=Cc2ccccc2Sc2c1cc(Cl)cc2)C | 10.1038/s41467-023-40064-9 | ||
DB09225 | 4153 | 61 | None | - | 53 | Human | 5.0 | pAC50 | = | 5.0 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 331 | 4 | 0 | 3 | 4.9 | CN(CCOC1=Cc2ccccc2Sc2c1cc(Cl)cc2)C | 10.1038/s41467-023-40064-9 | ||
1385580 | 29276 | 76 | None | - | 5 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 426 | 7 | 1 | 4 | 4.1 | O=c1[nH]c2ccccc2n1CCCN1CCN(C(c2ccccc2)c2ccccc2)CC1 | 10.1038/s41467-023-40064-9 | ||
4615 | 29276 | 76 | None | - | 5 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 426 | 7 | 1 | 4 | 4.1 | O=c1[nH]c2ccccc2n1CCCN1CCN(C(c2ccccc2)c2ccccc2)CC1 | 10.1038/s41467-023-40064-9 | ||
CHEMBL13828 | 29276 | 76 | None | - | 5 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 426 | 7 | 1 | 4 | 4.1 | O=c1[nH]c2ccccc2n1CCCN1CCN(C(c2ccccc2)c2ccccc2)CC1 | 10.1038/s41467-023-40064-9 | ||
392622 | 56312 | 95 | None | - | 4 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 720 | 17 | 4 | 9 | 5.9 | CC(C)c1nc(CN(C)C(=O)N[C@H](C(=O)N[C@@H](Cc2ccccc2)C[C@H](O)[C@H](Cc2ccccc2)NC(=O)OCc2cncs2)C(C)C)cs1 | 10.1038/s41467-023-40064-9 | ||
CHEMBL163 | 56312 | 95 | None | - | 4 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 720 | 17 | 4 | 9 | 5.9 | CC(C)c1nc(CN(C)C(=O)N[C@H](C(=O)N[C@@H](Cc2ccccc2)C[C@H](O)[C@H](Cc2ccccc2)NC(=O)OCc2cncs2)C(C)C)cs1 | 10.1038/s41467-023-40064-9 | ||
26987 | 949 | 33 | None | - | 21 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 343 | 6 | 0 | 2 | 5.1 | Clc1ccc(cc1)[C@@](c1ccccc1)(OCC[C@H]1CCCN1C)C | 10.1038/s41467-023-40064-9 | ||
6063 | 949 | 33 | None | - | 21 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 343 | 6 | 0 | 2 | 5.1 | Clc1ccc(cc1)[C@@](c1ccccc1)(OCC[C@H]1CCCN1C)C | 10.1038/s41467-023-40064-9 | ||
671 | 949 | 33 | None | - | 21 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 343 | 6 | 0 | 2 | 5.1 | Clc1ccc(cc1)[C@@](c1ccccc1)(OCC[C@H]1CCCN1C)C | 10.1038/s41467-023-40064-9 | ||
CHEMBL1626 | 949 | 33 | None | - | 21 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 343 | 6 | 0 | 2 | 5.1 | Clc1ccc(cc1)[C@@](c1ccccc1)(OCC[C@H]1CCCN1C)C | 10.1038/s41467-023-40064-9 | ||
DB00283 | 949 | 33 | None | - | 21 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 343 | 6 | 0 | 2 | 5.1 | Clc1ccc(cc1)[C@@](c1ccccc1)(OCC[C@H]1CCCN1C)C | 10.1038/s41467-023-40064-9 | ||
65866 | 94264 | 73 | None | - | 0 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 611 | 12 | 1 | 8 | 6.5 | COC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)(C)CN(C)CCC(c2ccccc2)c2ccccc2)C1c1cccc([N+](=O)[O-])c1 | 10.1038/s41467-023-40064-9 | ||
CHEMBL250270 | 94264 | 73 | None | - | 0 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 611 | 12 | 1 | 8 | 6.5 | COC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)(C)CN(C)CCC(c2ccccc2)c2ccccc2)C1c1cccc([N+](=O)[O-])c1 | 10.1038/s41467-023-40064-9 | ||
41684 | 31221 | 105 | None | - | 0 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 307 | 4 | 1 | 7 | 2.2 | CC(=O)Oc1ccccc1C(=O)Nc1ncc([N+](=O)[O-])s1 | 10.1038/s41467-023-40064-9 | ||
CHEMBL1401 | 31221 | 105 | None | - | 0 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 307 | 4 | 1 | 7 | 2.2 | CC(=O)Oc1ccccc1C(=O)Nc1ncc([N+](=O)[O-])s1 | 10.1038/s41467-023-40064-9 | ||
127151 | 35330 | 18 | None | - | 10 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 313 | 6 | 1 | 4 | 3.2 | CCOc1ccccc1OC(c1ccccc1)C1CNCCO1 | 10.1038/s41467-023-40064-9 | ||
3022645 | 35330 | 18 | None | - | 10 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 313 | 6 | 1 | 4 | 3.2 | CCOc1ccccc1OC(c1ccccc1)C1CNCCO1 | 10.1038/s41467-023-40064-9 | ||
CHEMBL14370 | 35330 | 18 | None | - | 10 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 313 | 6 | 1 | 4 | 3.2 | CCOc1ccccc1OC(c1ccccc1)C1CNCCO1 | 10.1038/s41467-023-40064-9 | ||
10184665 | 3991 | 51 | None | - | 0 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 485 | 16 | 4 | 6 | 4.6 | OCc1cc(ccc1O)[C@H](CNCCCCCCOCCOCc1c(Cl)cccc1Cl)O | 10.1038/s41467-023-40064-9 | ||
4799 | 3991 | 51 | None | - | 0 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 485 | 16 | 4 | 6 | 4.6 | OCc1cc(ccc1O)[C@H](CNCCCCCCOCCOCc1c(Cl)cccc1Cl)O | 10.1038/s41467-023-40064-9 | ||
7353 | 3991 | 51 | None | - | 0 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 485 | 16 | 4 | 6 | 4.6 | OCc1cc(ccc1O)[C@H](CNCCCCCCOCCOCc1c(Cl)cccc1Cl)O | 10.1038/s41467-023-40064-9 | ||
CHEMBL1198857 | 3991 | 51 | None | - | 0 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 485 | 16 | 4 | 6 | 4.6 | OCc1cc(ccc1O)[C@H](CNCCCCCCOCCOCc1c(Cl)cccc1Cl)O | 10.1038/s41467-023-40064-9 | ||
DB09082 | 3991 | 51 | None | - | 0 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 485 | 16 | 4 | 6 | 4.6 | OCc1cc(ccc1O)[C@H](CNCCCCCCOCCOCc1c(Cl)cccc1Cl)O | 10.1038/s41467-023-40064-9 | ||
25382 | 9157 | 37 | None | - | 0 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 291 | 3 | 0 | 1 | 4.7 | CN(C)CCC=C1c2ccccc2C(C)(C)c2ccccc21 | 10.1038/s41467-023-40064-9 | ||
CHEMBL110094 | 9157 | 37 | None | - | 0 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 291 | 3 | 0 | 1 | 4.7 | CN(C)CCC=C1c2ccccc2C(C)(C)c2ccccc21 | 10.1038/s41467-023-40064-9 | ||
24826799 | 10798 | 104 | None | - | 0 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 532 | 4 | 1 | 6 | 4.5 | Cc1ccc(C(=O)Nc2ccc(CN3CCN(C)CC3)c(C(F)(F)F)c2)cc1C#Cc1cnc2cccnn12 | 10.1038/s41467-023-40064-9 | ||
CHEMBL1171837 | 10798 | 104 | None | - | 0 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 532 | 4 | 1 | 6 | 4.5 | Cc1ccc(C(=O)Nc2ccc(CN3CCN(C)CC3)c(C(F)(F)F)c2)cc1C#Cc1cnc2cccnn12 | 10.1038/s41467-023-40064-9 | ||
16722836 | 18985 | 99 | None | - | 0 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 524 | 10 | 3 | 8 | 4.8 | Cc1cnc(Nc2ccc(OCCN3CCCC3)cc2)nc1Nc1cccc(S(=O)(=O)NC(C)(C)C)c1 | 10.1038/s41467-023-40064-9 | ||
CHEMBL1287853 | 18985 | 99 | None | - | 0 | Human | 4.9 | pAC50 | = | 4.9 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 524 | 10 | 3 | 8 | 4.8 | Cc1cnc(Nc2ccc(OCCN3CCCC3)cc2)nc1Nc1cccc(S(=O)(=O)NC(C)(C)C)c1 | 10.1038/s41467-023-40064-9 | ||
3784 | 57172 | 101 | None | - | 0 | Human | 4.8 | pAC50 | = | 4.8 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 371 | 4 | 1 | 8 | 2.6 | COC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)C)C1c1cccc2nonc12 | 10.1038/s41467-023-40064-9 | ||
CHEMBL1648 | 57172 | 101 | None | - | 0 | Human | 4.8 | pAC50 | = | 4.8 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 371 | 4 | 1 | 8 | 2.6 | COC(=O)C1=C(C)NC(C)=C(C(=O)OC(C)C)C1c1cccc2nonc12 | 10.1038/s41467-023-40064-9 | ||
4942 | 5718 | 50 | None | - | 0 | Human | 4.8 | pAC50 | = | 4.8 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 367 | 7 | 0 | 4 | 4.0 | CCCOC(C(=O)OC1CCN(C)CC1)(c1ccccc1)c1ccccc1 | 10.1038/s41467-023-40064-9 | ||
CHEMBL1078261 | 5718 | 50 | None | - | 0 | Human | 4.8 | pAC50 | = | 4.8 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 367 | 7 | 0 | 4 | 4.0 | CCCOC(C(=O)OC1CCN(C)CC1)(c1ccccc1)c1ccccc1 | 10.1038/s41467-023-40064-9 | ||
3191 | 102858 | 97 | None | - | 25 | Human | 6.8 | pAC50 | = | 6.8 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 469 | 9 | 0 | 3 | 7.2 | CC(C)(C)c1ccc(C(=O)CCCN2CCC(OC(c3ccccc3)c3ccccc3)CC2)cc1 | 10.1038/s41467-023-40064-9 | ||
CHEMBL305660 | 102858 | 97 | None | - | 25 | Human | 6.8 | pAC50 | = | 6.8 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 469 | 9 | 0 | 3 | 7.2 | CC(C)(C)c1ccc(C(=O)CCCN2CCC(OC(c3ccccc3)c3ccccc3)CC2)cc1 | 10.1038/s41467-023-40064-9 | ||
176 | 398 | 66 | None | - | 31 | Human | 4.8 | pAC50 | = | 4.8 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 645 | 11 | 0 | 4 | 6.9 | CCCCc1oc2c(c1C(=O)c1cc(I)c(c(c1)I)OCCN(CC)CC)cccc2 | 10.1038/s41467-023-40064-9 | ||
2157 | 398 | 66 | None | - | 31 | Human | 4.8 | pAC50 | = | 4.8 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 645 | 11 | 0 | 4 | 6.9 | CCCCc1oc2c(c1C(=O)c1cc(I)c(c(c1)I)OCCN(CC)CC)cccc2 | 10.1038/s41467-023-40064-9 | ||
2566 | 398 | 66 | None | - | 31 | Human | 4.8 | pAC50 | = | 4.8 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 645 | 11 | 0 | 4 | 6.9 | CCCCc1oc2c(c1C(=O)c1cc(I)c(c(c1)I)OCCN(CC)CC)cccc2 | 10.1038/s41467-023-40064-9 | ||
CHEMBL633 | 398 | 66 | None | - | 31 | Human | 4.8 | pAC50 | = | 4.8 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 645 | 11 | 0 | 4 | 6.9 | CCCCc1oc2c(c1C(=O)c1cc(I)c(c(c1)I)OCCN(CC)CC)cccc2 | 10.1038/s41467-023-40064-9 | ||
DB01118 | 398 | 66 | None | - | 31 | Human | 4.8 | pAC50 | = | 4.8 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 645 | 11 | 0 | 4 | 6.9 | CCCCc1oc2c(c1C(=O)c1cc(I)c(c(c1)I)OCCN(CC)CC)cccc2 | 10.1038/s41467-023-40064-9 | ||
65948 | 18556 | 109 | None | - | 0 | Human | 4.8 | pAC50 | = | 4.8 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 582 | 9 | 2 | 9 | 4.7 | CC1=C(C(=O)OC(C)C)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OC2CN(C(c3ccccc3)c3ccccc3)C2)=C(N)N1 | 10.1038/s41467-023-40064-9 | ||
CHEMBL1275868 | 18556 | 109 | None | - | 0 | Human | 4.8 | pAC50 | = | 4.8 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 582 | 9 | 2 | 9 | 4.7 | CC1=C(C(=O)OC(C)C)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OC2CN(C(c3ccccc3)c3ccccc3)C2)=C(N)N1 | 10.1038/s41467-023-40064-9 | ||
5284535 | 59111 | 26 | None | - | 0 | Human | 4.8 | pAC50 | = | 4.8 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 392 | 2 | 3 | 5 | 1.9 | C[C@]12C=CC(=O)C=C1C(Cl)=C[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CO | 10.1038/s41467-023-40064-9 | ||
CHEMBL1697832 | 59111 | 26 | None | - | 0 | Human | 4.8 | pAC50 | = | 4.8 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 392 | 2 | 3 | 5 | 1.9 | C[C@]12C=CC(=O)C=C1C(Cl)=C[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CO | 10.1038/s41467-023-40064-9 | ||
154257 | 178619 | 67 | None | - | 0 | Human | 4.8 | pAC50 | = | 4.8 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 470 | 7 | 2 | 5 | 6.3 | Cc1c(-c2ccc(O)cc2)n(Cc2ccc(OCCN3CCCCCC3)cc2)c2ccc(O)cc12 | 10.1038/s41467-023-40064-9 | ||
CHEMBL46740 | 178619 | 67 | None | - | 0 | Human | 4.8 | pAC50 | = | 4.8 | Binding | Binding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human MLNR in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 470 | 7 | 2 | 5 | 6.3 | Cc1c(-c2ccc(O)cc2)n(Cc2ccc(OCCN3CCCCCC3)cc2)c2ccc(O)cc12 | 10.1038/s41467-023-40064-9 |
Showing 1 to 50 of 632 entries