Ligand source activities (1 row/activity)
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
| 6433 | 3857 | None | 0 | Human | Functional | pIC50 | = | 5.9 | 5.9 | -10 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | 563 | 10 | 4 | 9 | 2.2 | COc1ccc(cc1)Cn1c(NCCNC(=N)NC(=O)c2ccc(cc2)F)nc(=O)n(c1=O)Cc1ccc(cc1)F | 21421710 | ||
| 73755221 | 3857 | None | 0 | Human | Functional | pIC50 | = | 5.9 | 5.9 | -10 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | 563 | 10 | 4 | 9 | 2.2 | COc1ccc(cc1)Cn1c(NCCNC(=N)NC(=O)c2ccc(cc2)F)nc(=O)n(c1=O)Cc1ccc(cc1)F | 21421710 | ||
| 1866 | 3177 | None | 0 | Human | Functional | pIC50 | = | 7.2 | 7.2 | 1 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 12054613 | ||||
| 1866 | 3177 | None | 0 | Human | Functional | pIC50 | = | 7.2 | 7.2 | 1 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 15772293 | ||||
| 16122905 | 3135 | None | 0 | Human | Functional | pIC50 | = | 7.3 | 7.3 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | 438 | 7 | 0 | 5 | 3.7 | CC(CN(C(=O)C1OCCN(C1)Cc1ccccc1)Cc1ccc2c(c1)OCCCO2)C | 22431614 | ||
| 6066 | 3135 | None | 0 | Human | Functional | pIC50 | = | 7.3 | 7.3 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | 438 | 7 | 0 | 5 | 3.7 | CC(CN(C(=O)C1OCCN(C1)Cc1ccccc1)Cc1ccc2c(c1)OCCCO2)C | 22431614 | ||
| 1867 | 3180 | None | 0 | Human | Functional | pIC50 | = | 8.2 | 8.2 | -1 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 12054613 | ||||
| 1867 | 3180 | None | 0 | Human | Functional | pIC50 | = | 8.2 | 8.2 | -1 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 15772293 | ||||
| 1865 | 2543 | None | 0 | Human | Functional | pIC50 | = | 9.2 | 9.2 | 6 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 12054613 | ||||
| 1868 | 3181 | None | 0 | Human | Functional | pIC50 | > | 6 | 6.0 | -31 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 15772293 | ||||
Showing 1 to 10 of 10 entries
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
| 11951384 | 3856 | None | 0 | Human | Binding | pKi | = | 5.8 | 5.8 | -74 | 2 | Displacement of [I125]MIT from PKR2 expressed in CHO cell membraneDisplacement of [I125]MIT from PKR2 expressed in CHO cell membrane |
ChEMBL | 451 | 10 | 3 | 8 | 0.8 | CCc1ccc(cc1)Cn1c(=O)nc(n(c1=O)Cc1ccc(cc1)OC)NCCN=C(N)N | 10.1021/jm800854e | ||
| 6064 | 3856 | None | 0 | Human | Binding | pKi | = | 5.8 | 5.8 | -74 | 2 | Displacement of [I125]MIT from PKR2 expressed in CHO cell membraneDisplacement of [I125]MIT from PKR2 expressed in CHO cell membrane |
ChEMBL | 451 | 10 | 3 | 8 | 0.8 | CCc1ccc(cc1)Cn1c(=O)nc(n(c1=O)Cc1ccc(cc1)OC)NCCN=C(N)N | 10.1021/jm800854e | ||
| CHEMBL457515 | 3856 | None | 0 | Human | Binding | pKi | = | 5.8 | 5.8 | -74 | 2 | Displacement of [I125]MIT from PKR2 expressed in CHO cell membraneDisplacement of [I125]MIT from PKR2 expressed in CHO cell membrane |
ChEMBL | 451 | 10 | 3 | 8 | 0.8 | CCc1ccc(cc1)Cn1c(=O)nc(n(c1=O)Cc1ccc(cc1)OC)NCCN=C(N)N | 10.1021/jm800854e | ||
| 25138121 | 189732 | None | 0 | Human | Binding | pKi | = | 4.6 | 4.6 | -53 | 2 | Displacement of [I125]MIT from PKR2 expressed in CHO cell membraneDisplacement of [I125]MIT from PKR2 expressed in CHO cell membrane |
ChEMBL | 409 | 9 | 2 | 8 | 1.4 | CCc1ccc(Cn2c(=O)nc(NCCN)n(Cc3ccc(OC)cc3)c2=O)cc1 | 10.1021/jm800854e | ||
| CHEMBL514895 | 189732 | None | 0 | Human | Binding | pKi | = | 4.6 | 4.6 | -53 | 2 | Displacement of [I125]MIT from PKR2 expressed in CHO cell membraneDisplacement of [I125]MIT from PKR2 expressed in CHO cell membrane |
ChEMBL | 409 | 9 | 2 | 8 | 1.4 | CCc1ccc(Cn2c(=O)nc(NCCN)n(Cc3ccc(OC)cc3)c2=O)cc1 | 10.1021/jm800854e | ||
| 25138122 | 176203 | None | 0 | Human | Binding | pKi | = | 4.2 | 4.2 | -15 | 2 | Displacement of [I125]MIT from PKR2 expressed in CHO cell membraneDisplacement of [I125]MIT from PKR2 expressed in CHO cell membrane |
ChEMBL | 477 | 10 | 3 | 10 | 1.0 | CCc1ccc(Cn2c(=O)nc(NCCNC3=NCCN3)n(Cc3ccc(OC)cc3)c2=O)cc1 | 10.1021/jm800854e | ||
| CHEMBL459142 | 176203 | None | 0 | Human | Binding | pKi | = | 4.2 | 4.2 | -15 | 2 | Displacement of [I125]MIT from PKR2 expressed in CHO cell membraneDisplacement of [I125]MIT from PKR2 expressed in CHO cell membrane |
ChEMBL | 477 | 10 | 3 | 10 | 1.0 | CCc1ccc(Cn2c(=O)nc(NCCNC3=NCCN3)n(Cc3ccc(OC)cc3)c2=O)cc1 | 10.1021/jm800854e | ||
| 11951384 | 3856 | None | 0 | Human | Binding | pKi | = | 5.8 | 5.8 | -74 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | 451 | 10 | 3 | 8 | 0.8 | CCc1ccc(cc1)Cn1c(=O)nc(n(c1=O)Cc1ccc(cc1)OC)NCCN=C(N)N | 19006379 | ||
| 6064 | 3856 | None | 0 | Human | Binding | pKi | = | 5.8 | 5.8 | -74 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | 451 | 10 | 3 | 8 | 0.8 | CCc1ccc(cc1)Cn1c(=O)nc(n(c1=O)Cc1ccc(cc1)OC)NCCN=C(N)N | 19006379 | ||
| CHEMBL457515 | 3856 | None | 0 | Human | Binding | pKi | = | 5.8 | 5.8 | -74 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | 451 | 10 | 3 | 8 | 0.8 | CCc1ccc(cc1)Cn1c(=O)nc(n(c1=O)Cc1ccc(cc1)OC)NCCN=C(N)N | 19006379 | ||
Showing 1 to 10 of 10 entries