Ligand source activities (1 row/activity)
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
| 71508233 | 87108 | None | 0 | Human | Functional | pEC50 | = | 10.6 | 10.6 | 676 | 2 | Agonist activity at human MT2 receptor expressed in CHO cells coexpressing Galpha protein 16z25 assessed as increase in calcium mobilization measured for 3 mins by FLIPR assayAgonist activity at human MT2 receptor expressed in CHO cells coexpressing Galpha protein 16z25 assessed as increase in calcium mobilization measured for 3 mins by FLIPR assay |
ChEMBL | 355 | 10 | 1 | 3 | 3.9 | CCC(=O)NCCCc1cc(OC)ccc1CCc1cccc(OC)c1 | 10.1016/j.bmc.2012.10.060 | ||
| CHEMBL2326201 | 87108 | None | 0 | Human | Functional | pEC50 | = | 10.6 | 10.6 | 676 | 2 | Agonist activity at human MT2 receptor expressed in CHO cells coexpressing Galpha protein 16z25 assessed as increase in calcium mobilization measured for 3 mins by FLIPR assayAgonist activity at human MT2 receptor expressed in CHO cells coexpressing Galpha protein 16z25 assessed as increase in calcium mobilization measured for 3 mins by FLIPR assay |
ChEMBL | 355 | 10 | 1 | 3 | 3.9 | CCC(=O)NCCCc1cc(OC)ccc1CCc1cccc(OC)c1 | 10.1016/j.bmc.2012.10.060 | ||
| 139451781 | 184964 | None | 0 | Human | Functional | pEC50 | = | 10.3 | 10.3 | 2 | 2 | Agonist activity at human MT2 receptor expressed in CHO cells assessed as increase in cAMP production incubated at 37 degreeC by fluorometric methodAgonist activity at human MT2 receptor expressed in CHO cells assessed as increase in cAMP production incubated at 37 degreeC by fluorometric method |
ChEMBL | 289 | 5 | 1 | 5 | 1.5 | CCOc1nc2ccc3c(c2n1CCNC(C)=O)CCO3 | 10.1021/acs.jmedchem.0c00627 | ||
| CHEMBL4852440 | 184964 | None | 0 | Human | Functional | pEC50 | = | 10.3 | 10.3 | 2 | 2 | Agonist activity at human MT2 receptor expressed in CHO cells assessed as increase in cAMP production incubated at 37 degreeC by fluorometric methodAgonist activity at human MT2 receptor expressed in CHO cells assessed as increase in cAMP production incubated at 37 degreeC by fluorometric method |
ChEMBL | 289 | 5 | 1 | 5 | 1.5 | CCOc1nc2ccc3c(c2n1CCNC(C)=O)CCO3 | 10.1021/acs.jmedchem.0c00627 | ||
| 46865422 | 87105 | None | 0 | Human | Functional | pEC50 | = | 10.3 | 10.3 | 181 | 2 | Agonist activity at human MT2 receptor expressed in CHO cells coexpressing Galpha protein 16z25 assessed as increase in calcium mobilization measured for 3 mins by FLIPR assayAgonist activity at human MT2 receptor expressed in CHO cells coexpressing Galpha protein 16z25 assessed as increase in calcium mobilization measured for 3 mins by FLIPR assay |
ChEMBL | 357 | 10 | 1 | 4 | 3.7 | CCC(=O)NCCCc1cc(OC)ccc1OCc1cccc(OC)c1 | 10.1016/j.bmc.2012.10.060 | ||
| CHEMBL2326199 | 87105 | None | 0 | Human | Functional | pEC50 | = | 10.3 | 10.3 | 181 | 2 | Agonist activity at human MT2 receptor expressed in CHO cells coexpressing Galpha protein 16z25 assessed as increase in calcium mobilization measured for 3 mins by FLIPR assayAgonist activity at human MT2 receptor expressed in CHO cells coexpressing Galpha protein 16z25 assessed as increase in calcium mobilization measured for 3 mins by FLIPR assay |
ChEMBL | 357 | 10 | 1 | 4 | 3.7 | CCC(=O)NCCCc1cc(OC)ccc1OCc1cccc(OC)c1 | 10.1016/j.bmc.2012.10.060 | ||
| 139451764 | 186373 | None | 0 | Human | Functional | pEC50 | = | 10.2 | 10.2 | 2 | 2 | Agonist activity at human MT2 receptor expressed in CHO cells assessed as increase in cAMP production incubated at 37 degreeC by fluorometric methodAgonist activity at human MT2 receptor expressed in CHO cells assessed as increase in cAMP production incubated at 37 degreeC by fluorometric method |
ChEMBL | 275 | 4 | 1 | 5 | 1.1 | COc1nc2ccc3c(c2n1CCNC(C)=O)CCO3 | 10.1021/acs.jmedchem.0c00627 | ||
| CHEMBL4873903 | 186373 | None | 0 | Human | Functional | pEC50 | = | 10.2 | 10.2 | 2 | 2 | Agonist activity at human MT2 receptor expressed in CHO cells assessed as increase in cAMP production incubated at 37 degreeC by fluorometric methodAgonist activity at human MT2 receptor expressed in CHO cells assessed as increase in cAMP production incubated at 37 degreeC by fluorometric method |
ChEMBL | 275 | 4 | 1 | 5 | 1.1 | COc1nc2ccc3c(c2n1CCNC(C)=O)CCO3 | 10.1021/acs.jmedchem.0c00627 | ||
| 1357 | 2485 | None | 75 | Human | Functional | pEC50 | = | 10.2 | 10.2 | -1 | 5 | Agonist activity at human melatonin receptor-2 transfected in CHO cell membranes after 1 hr by GTPgammaS binding assayAgonist activity at human melatonin receptor-2 transfected in CHO cell membranes after 1 hr by GTPgammaS binding assay |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1021/acs.jmedchem.5b00245 | ||
| 1672 | 2485 | None | 75 | Human | Functional | pEC50 | = | 10.2 | 10.2 | -1 | 5 | Agonist activity at human melatonin receptor-2 transfected in CHO cell membranes after 1 hr by GTPgammaS binding assayAgonist activity at human melatonin receptor-2 transfected in CHO cell membranes after 1 hr by GTPgammaS binding assay |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1021/acs.jmedchem.5b00245 | ||
| 224 | 2485 | None | 75 | Human | Functional | pEC50 | = | 10.2 | 10.2 | -1 | 5 | Agonist activity at human melatonin receptor-2 transfected in CHO cell membranes after 1 hr by GTPgammaS binding assayAgonist activity at human melatonin receptor-2 transfected in CHO cell membranes after 1 hr by GTPgammaS binding assay |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1021/acs.jmedchem.5b00245 | ||
| 896 | 2485 | None | 75 | Human | Functional | pEC50 | = | 10.2 | 10.2 | -1 | 5 | Agonist activity at human melatonin receptor-2 transfected in CHO cell membranes after 1 hr by GTPgammaS binding assayAgonist activity at human melatonin receptor-2 transfected in CHO cell membranes after 1 hr by GTPgammaS binding assay |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1021/acs.jmedchem.5b00245 | ||
| CHEMBL45 | 2485 | None | 75 | Human | Functional | pEC50 | = | 10.2 | 10.2 | -1 | 5 | Agonist activity at human melatonin receptor-2 transfected in CHO cell membranes after 1 hr by GTPgammaS binding assayAgonist activity at human melatonin receptor-2 transfected in CHO cell membranes after 1 hr by GTPgammaS binding assay |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1021/acs.jmedchem.5b00245 | ||
| DB01065 | 2485 | None | 75 | Human | Functional | pEC50 | = | 10.2 | 10.2 | -1 | 5 | Agonist activity at human melatonin receptor-2 transfected in CHO cell membranes after 1 hr by GTPgammaS binding assayAgonist activity at human melatonin receptor-2 transfected in CHO cell membranes after 1 hr by GTPgammaS binding assay |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1021/acs.jmedchem.5b00245 | ||
| 198 | 313 | None | 72 | Human | Functional | pEC50 | = | 10.2 | 10.2 | 3 | 4 | Agonist activity at human MT2 receptor expressed in CHO cells after 1 hr by [35S]GTPgammaS binding assayAgonist activity at human MT2 receptor expressed in CHO cells after 1 hr by [35S]GTPgammaS binding assay |
ChEMBL | 243 | 4 | 1 | 2 | 2.5 | COc1ccc2c(c1)c(CCNC(=O)C)ccc2 | 10.1039/C4MD00149D | ||
| 82148 | 313 | None | 72 | Human | Functional | pEC50 | = | 10.2 | 10.2 | 3 | 4 | Agonist activity at human MT2 receptor expressed in CHO cells after 1 hr by [35S]GTPgammaS binding assayAgonist activity at human MT2 receptor expressed in CHO cells after 1 hr by [35S]GTPgammaS binding assay |
ChEMBL | 243 | 4 | 1 | 2 | 2.5 | COc1ccc2c(c1)c(CCNC(=O)C)ccc2 | 10.1039/C4MD00149D | ||
| 82148.0 | 313 | None | 72 | Human | Functional | pEC50 | = | 10.2 | 10.2 | 3 | 4 | Agonist activity at human MT2 receptor expressed in CHO cells after 1 hr by [35S]GTPgammaS binding assayAgonist activity at human MT2 receptor expressed in CHO cells after 1 hr by [35S]GTPgammaS binding assay |
ChEMBL | 243 | 4 | 1 | 2 | 2.5 | COc1ccc2c(c1)c(CCNC(=O)C)ccc2 | 10.1039/C4MD00149D | ||
| 99 | 313 | None | 72 | Human | Functional | pEC50 | = | 10.2 | 10.2 | 3 | 4 | Agonist activity at human MT2 receptor expressed in CHO cells after 1 hr by [35S]GTPgammaS binding assayAgonist activity at human MT2 receptor expressed in CHO cells after 1 hr by [35S]GTPgammaS binding assay |
ChEMBL | 243 | 4 | 1 | 2 | 2.5 | COc1ccc2c(c1)c(CCNC(=O)C)ccc2 | 10.1039/C4MD00149D | ||
| CHEMBL10878 | 313 | None | 72 | Human | Functional | pEC50 | = | 10.2 | 10.2 | 3 | 4 | Agonist activity at human MT2 receptor expressed in CHO cells after 1 hr by [35S]GTPgammaS binding assayAgonist activity at human MT2 receptor expressed in CHO cells after 1 hr by [35S]GTPgammaS binding assay |
ChEMBL | 243 | 4 | 1 | 2 | 2.5 | COc1ccc2c(c1)c(CCNC(=O)C)ccc2 | 10.1039/C4MD00149D | ||
| DB06594 | 313 | None | 72 | Human | Functional | pEC50 | = | 10.2 | 10.2 | 3 | 4 | Agonist activity at human MT2 receptor expressed in CHO cells after 1 hr by [35S]GTPgammaS binding assayAgonist activity at human MT2 receptor expressed in CHO cells after 1 hr by [35S]GTPgammaS binding assay |
ChEMBL | 243 | 4 | 1 | 2 | 2.5 | COc1ccc2c(c1)c(CCNC(=O)C)ccc2 | 10.1039/C4MD00149D | ||
| 1357 | 2485 | None | 75 | Human | Functional | pEC50 | = | 10.2 | 10.2 | -1 | 5 | Agonist activity at human MT2 receptor expressed in CHO cells assessed as increase in cAMP production incubated at 37 degreeC by fluorometric methodAgonist activity at human MT2 receptor expressed in CHO cells assessed as increase in cAMP production incubated at 37 degreeC by fluorometric method |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1021/acs.jmedchem.0c00627 | ||
| 1672 | 2485 | None | 75 | Human | Functional | pEC50 | = | 10.2 | 10.2 | -1 | 5 | Agonist activity at human MT2 receptor expressed in CHO cells assessed as increase in cAMP production incubated at 37 degreeC by fluorometric methodAgonist activity at human MT2 receptor expressed in CHO cells assessed as increase in cAMP production incubated at 37 degreeC by fluorometric method |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1021/acs.jmedchem.0c00627 | ||
| 224 | 2485 | None | 75 | Human | Functional | pEC50 | = | 10.2 | 10.2 | -1 | 5 | Agonist activity at human MT2 receptor expressed in CHO cells assessed as increase in cAMP production incubated at 37 degreeC by fluorometric methodAgonist activity at human MT2 receptor expressed in CHO cells assessed as increase in cAMP production incubated at 37 degreeC by fluorometric method |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1021/acs.jmedchem.0c00627 | ||
| 896 | 2485 | None | 75 | Human | Functional | pEC50 | = | 10.2 | 10.2 | -1 | 5 | Agonist activity at human MT2 receptor expressed in CHO cells assessed as increase in cAMP production incubated at 37 degreeC by fluorometric methodAgonist activity at human MT2 receptor expressed in CHO cells assessed as increase in cAMP production incubated at 37 degreeC by fluorometric method |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1021/acs.jmedchem.0c00627 | ||
| CHEMBL45 | 2485 | None | 75 | Human | Functional | pEC50 | = | 10.2 | 10.2 | -1 | 5 | Agonist activity at human MT2 receptor expressed in CHO cells assessed as increase in cAMP production incubated at 37 degreeC by fluorometric methodAgonist activity at human MT2 receptor expressed in CHO cells assessed as increase in cAMP production incubated at 37 degreeC by fluorometric method |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1021/acs.jmedchem.0c00627 | ||
| DB01065 | 2485 | None | 75 | Human | Functional | pEC50 | = | 10.2 | 10.2 | -1 | 5 | Agonist activity at human MT2 receptor expressed in CHO cells assessed as increase in cAMP production incubated at 37 degreeC by fluorometric methodAgonist activity at human MT2 receptor expressed in CHO cells assessed as increase in cAMP production incubated at 37 degreeC by fluorometric method |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1021/acs.jmedchem.0c00627 | ||
| 1357 | 2485 | None | 75 | Human | Functional | pEC50 | = | 10.1 | 10.1 | -1 | 5 | Agonist activity at human melatonin MT2 receptor expressed in HEK293 cells co-transfected with Galphai9 chimera construct assessed as stimulation of inositol phosphate production by HTRF based assayAgonist activity at human melatonin MT2 receptor expressed in HEK293 cells co-transfected with Galphai9 chimera construct assessed as stimulation of inositol phosphate production by HTRF based assay |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1016/j.ejmech.2023.115152 | ||
| 1672 | 2485 | None | 75 | Human | Functional | pEC50 | = | 10.1 | 10.1 | -1 | 5 | Agonist activity at human melatonin MT2 receptor expressed in HEK293 cells co-transfected with Galphai9 chimera construct assessed as stimulation of inositol phosphate production by HTRF based assayAgonist activity at human melatonin MT2 receptor expressed in HEK293 cells co-transfected with Galphai9 chimera construct assessed as stimulation of inositol phosphate production by HTRF based assay |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1016/j.ejmech.2023.115152 | ||
| 224 | 2485 | None | 75 | Human | Functional | pEC50 | = | 10.1 | 10.1 | -1 | 5 | Agonist activity at human melatonin MT2 receptor expressed in HEK293 cells co-transfected with Galphai9 chimera construct assessed as stimulation of inositol phosphate production by HTRF based assayAgonist activity at human melatonin MT2 receptor expressed in HEK293 cells co-transfected with Galphai9 chimera construct assessed as stimulation of inositol phosphate production by HTRF based assay |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1016/j.ejmech.2023.115152 | ||
| 896 | 2485 | None | 75 | Human | Functional | pEC50 | = | 10.1 | 10.1 | -1 | 5 | Agonist activity at human melatonin MT2 receptor expressed in HEK293 cells co-transfected with Galphai9 chimera construct assessed as stimulation of inositol phosphate production by HTRF based assayAgonist activity at human melatonin MT2 receptor expressed in HEK293 cells co-transfected with Galphai9 chimera construct assessed as stimulation of inositol phosphate production by HTRF based assay |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1016/j.ejmech.2023.115152 | ||
| CHEMBL45 | 2485 | None | 75 | Human | Functional | pEC50 | = | 10.1 | 10.1 | -1 | 5 | Agonist activity at human melatonin MT2 receptor expressed in HEK293 cells co-transfected with Galphai9 chimera construct assessed as stimulation of inositol phosphate production by HTRF based assayAgonist activity at human melatonin MT2 receptor expressed in HEK293 cells co-transfected with Galphai9 chimera construct assessed as stimulation of inositol phosphate production by HTRF based assay |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1016/j.ejmech.2023.115152 | ||
| DB01065 | 2485 | None | 75 | Human | Functional | pEC50 | = | 10.1 | 10.1 | -1 | 5 | Agonist activity at human melatonin MT2 receptor expressed in HEK293 cells co-transfected with Galphai9 chimera construct assessed as stimulation of inositol phosphate production by HTRF based assayAgonist activity at human melatonin MT2 receptor expressed in HEK293 cells co-transfected with Galphai9 chimera construct assessed as stimulation of inositol phosphate production by HTRF based assay |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1016/j.ejmech.2023.115152 | ||
| 139451763 | 186439 | None | 0 | Human | Functional | pEC50 | = | 10.1 | 10.1 | 1 | 2 | Agonist activity at human MT2 receptor expressed in CHO cells assessed as increase in cAMP production incubated at 37 degreeC by fluorometric methodAgonist activity at human MT2 receptor expressed in CHO cells assessed as increase in cAMP production incubated at 37 degreeC by fluorometric method |
ChEMBL | 305 | 8 | 1 | 5 | 2.4 | CCCC(=O)NCCn1c(OCC)nc2ccc(OC)cc21 | 10.1021/acs.jmedchem.0c00627 | ||
| CHEMBL4874954 | 186439 | None | 0 | Human | Functional | pEC50 | = | 10.1 | 10.1 | 1 | 2 | Agonist activity at human MT2 receptor expressed in CHO cells assessed as increase in cAMP production incubated at 37 degreeC by fluorometric methodAgonist activity at human MT2 receptor expressed in CHO cells assessed as increase in cAMP production incubated at 37 degreeC by fluorometric method |
ChEMBL | 305 | 8 | 1 | 5 | 2.4 | CCCC(=O)NCCn1c(OCC)nc2ccc(OC)cc21 | 10.1021/acs.jmedchem.0c00627 | ||
| 137647756 | 158036 | None | 0 | Human | Functional | pEC50 | = | 10.1 | 10.1 | 213 | 2 | Intrinsic activity at human MT2 receptor expressed in CHO cell membranes after 1 hr by [35S]GTPgammaS binding assayIntrinsic activity at human MT2 receptor expressed in CHO cell membranes after 1 hr by [35S]GTPgammaS binding assay |
ChEMBL | 259 | 4 | 2 | 3 | 1.7 | CNC(=O)NCCc1cccc2ccc(OC)nc12 | 10.1016/j.ejmech.2016.12.013 | ||
| CHEMBL4084612 | 158036 | None | 0 | Human | Functional | pEC50 | = | 10.1 | 10.1 | 213 | 2 | Intrinsic activity at human MT2 receptor expressed in CHO cell membranes after 1 hr by [35S]GTPgammaS binding assayIntrinsic activity at human MT2 receptor expressed in CHO cell membranes after 1 hr by [35S]GTPgammaS binding assay |
ChEMBL | 259 | 4 | 2 | 3 | 1.7 | CNC(=O)NCCc1cccc2ccc(OC)nc12 | 10.1016/j.ejmech.2016.12.013 | ||
| 9839629 | 100170 | None | 0 | Human | Functional | pEC50 | = | 10.0 | 10.0 | 1 | 2 | Intrinsic activity at human Melatonin receptor type 1B evaluated on [35S]GTP-gamma-S, binding in Chinese hamster ovarian (CHO) cellsIntrinsic activity at human Melatonin receptor type 1B evaluated on [35S]GTP-gamma-S, binding in Chinese hamster ovarian (CHO) cells |
ChEMBL | 309 | 5 | 1 | 3 | 3.8 | COc1ccc2oc(-c3ccccc3)c(CCNC(C)=O)c2c1 | 10.1021/jm0005252 | ||
| CHEMBL287560 | 100170 | None | 0 | Human | Functional | pEC50 | = | 10.0 | 10.0 | 1 | 2 | Intrinsic activity at human Melatonin receptor type 1B evaluated on [35S]GTP-gamma-S, binding in Chinese hamster ovarian (CHO) cellsIntrinsic activity at human Melatonin receptor type 1B evaluated on [35S]GTP-gamma-S, binding in Chinese hamster ovarian (CHO) cells |
ChEMBL | 309 | 5 | 1 | 3 | 3.8 | COc1ccc2oc(-c3ccccc3)c(CCNC(C)=O)c2c1 | 10.1021/jm0005252 | ||
| 198 | 313 | None | 72 | Human | Functional | pEC50 | = | 10 | 10.0 | 3 | 4 | Agonist activity at human MT2 receptor expressed in CHO cells by [35S]GTPgamma binding assayAgonist activity at human MT2 receptor expressed in CHO cells by [35S]GTPgamma binding assay |
ChEMBL | 243 | 4 | 1 | 2 | 2.5 | COc1ccc2c(c1)c(CCNC(=O)C)ccc2 | 10.1016/j.bmc.2010.04.008 | ||
| 82148 | 313 | None | 72 | Human | Functional | pEC50 | = | 10 | 10.0 | 3 | 4 | Agonist activity at human MT2 receptor expressed in CHO cells by [35S]GTPgamma binding assayAgonist activity at human MT2 receptor expressed in CHO cells by [35S]GTPgamma binding assay |
ChEMBL | 243 | 4 | 1 | 2 | 2.5 | COc1ccc2c(c1)c(CCNC(=O)C)ccc2 | 10.1016/j.bmc.2010.04.008 | ||
| 82148.0 | 313 | None | 72 | Human | Functional | pEC50 | = | 10 | 10.0 | 3 | 4 | Agonist activity at human MT2 receptor expressed in CHO cells by [35S]GTPgamma binding assayAgonist activity at human MT2 receptor expressed in CHO cells by [35S]GTPgamma binding assay |
ChEMBL | 243 | 4 | 1 | 2 | 2.5 | COc1ccc2c(c1)c(CCNC(=O)C)ccc2 | 10.1016/j.bmc.2010.04.008 | ||
| 99 | 313 | None | 72 | Human | Functional | pEC50 | = | 10 | 10.0 | 3 | 4 | Agonist activity at human MT2 receptor expressed in CHO cells by [35S]GTPgamma binding assayAgonist activity at human MT2 receptor expressed in CHO cells by [35S]GTPgamma binding assay |
ChEMBL | 243 | 4 | 1 | 2 | 2.5 | COc1ccc2c(c1)c(CCNC(=O)C)ccc2 | 10.1016/j.bmc.2010.04.008 | ||
| CHEMBL10878 | 313 | None | 72 | Human | Functional | pEC50 | = | 10 | 10.0 | 3 | 4 | Agonist activity at human MT2 receptor expressed in CHO cells by [35S]GTPgamma binding assayAgonist activity at human MT2 receptor expressed in CHO cells by [35S]GTPgamma binding assay |
ChEMBL | 243 | 4 | 1 | 2 | 2.5 | COc1ccc2c(c1)c(CCNC(=O)C)ccc2 | 10.1016/j.bmc.2010.04.008 | ||
| DB06594 | 313 | None | 72 | Human | Functional | pEC50 | = | 10 | 10.0 | 3 | 4 | Agonist activity at human MT2 receptor expressed in CHO cells by [35S]GTPgamma binding assayAgonist activity at human MT2 receptor expressed in CHO cells by [35S]GTPgamma binding assay |
ChEMBL | 243 | 4 | 1 | 2 | 2.5 | COc1ccc2c(c1)c(CCNC(=O)C)ccc2 | 10.1016/j.bmc.2010.04.008 | ||
| 198 | 313 | None | 72 | Human | Functional | pEC50 | = | 10 | 10.0 | 3 | 4 | Agonist activity at human MT2 receptor expressed in CHO cells by [35S]GTPgammaS binding assayAgonist activity at human MT2 receptor expressed in CHO cells by [35S]GTPgammaS binding assay |
ChEMBL | 243 | 4 | 1 | 2 | 2.5 | COc1ccc2c(c1)c(CCNC(=O)C)ccc2 | 10.1016/j.bmc.2008.08.052 | ||
| 82148 | 313 | None | 72 | Human | Functional | pEC50 | = | 10 | 10.0 | 3 | 4 | Agonist activity at human MT2 receptor expressed in CHO cells by [35S]GTPgammaS binding assayAgonist activity at human MT2 receptor expressed in CHO cells by [35S]GTPgammaS binding assay |
ChEMBL | 243 | 4 | 1 | 2 | 2.5 | COc1ccc2c(c1)c(CCNC(=O)C)ccc2 | 10.1016/j.bmc.2008.08.052 | ||
| 82148.0 | 313 | None | 72 | Human | Functional | pEC50 | = | 10 | 10.0 | 3 | 4 | Agonist activity at human MT2 receptor expressed in CHO cells by [35S]GTPgammaS binding assayAgonist activity at human MT2 receptor expressed in CHO cells by [35S]GTPgammaS binding assay |
ChEMBL | 243 | 4 | 1 | 2 | 2.5 | COc1ccc2c(c1)c(CCNC(=O)C)ccc2 | 10.1016/j.bmc.2008.08.052 | ||
| 99 | 313 | None | 72 | Human | Functional | pEC50 | = | 10 | 10.0 | 3 | 4 | Agonist activity at human MT2 receptor expressed in CHO cells by [35S]GTPgammaS binding assayAgonist activity at human MT2 receptor expressed in CHO cells by [35S]GTPgammaS binding assay |
ChEMBL | 243 | 4 | 1 | 2 | 2.5 | COc1ccc2c(c1)c(CCNC(=O)C)ccc2 | 10.1016/j.bmc.2008.08.052 | ||
| CHEMBL10878 | 313 | None | 72 | Human | Functional | pEC50 | = | 10 | 10.0 | 3 | 4 | Agonist activity at human MT2 receptor expressed in CHO cells by [35S]GTPgammaS binding assayAgonist activity at human MT2 receptor expressed in CHO cells by [35S]GTPgammaS binding assay |
ChEMBL | 243 | 4 | 1 | 2 | 2.5 | COc1ccc2c(c1)c(CCNC(=O)C)ccc2 | 10.1016/j.bmc.2008.08.052 | ||
| DB06594 | 313 | None | 72 | Human | Functional | pEC50 | = | 10 | 10.0 | 3 | 4 | Agonist activity at human MT2 receptor expressed in CHO cells by [35S]GTPgammaS binding assayAgonist activity at human MT2 receptor expressed in CHO cells by [35S]GTPgammaS binding assay |
ChEMBL | 243 | 4 | 1 | 2 | 2.5 | COc1ccc2c(c1)c(CCNC(=O)C)ccc2 | 10.1016/j.bmc.2008.08.052 | ||
Showing 1 to 50 of 483 entries
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
| 10440 | 2680 | None | 22 | Human | Binding | pEC50 | = | 6.3 | 6.3 | -3 | 3 | Agonist activity at human MT2 receptor expressed in HTLA cells assessed as stimulation of beta-arrestin recruitment incubated for 16 to 20 hrs by bright-glo luminescence assayAgonist activity at human MT2 receptor expressed in HTLA cells assessed as stimulation of beta-arrestin recruitment incubated for 16 to 20 hrs by bright-glo luminescence assay |
ChEMBL | 417 | 7 | 3 | 7 | 4.2 | OCc1cccc(c1c1nc(NCc2ccc(cc2)Oc2ccccc2)nc(n1)N)F | 10.1021/acs.jmedchem.9b00869 | ||
| 139030523 | 2680 | None | 22 | Human | Binding | pEC50 | = | 6.3 | 6.3 | -3 | 3 | Agonist activity at human MT2 receptor expressed in HTLA cells assessed as stimulation of beta-arrestin recruitment incubated for 16 to 20 hrs by bright-glo luminescence assayAgonist activity at human MT2 receptor expressed in HTLA cells assessed as stimulation of beta-arrestin recruitment incubated for 16 to 20 hrs by bright-glo luminescence assay |
ChEMBL | 417 | 7 | 3 | 7 | 4.2 | OCc1cccc(c1c1nc(NCc2ccc(cc2)Oc2ccccc2)nc(n1)N)F | 10.1021/acs.jmedchem.9b00869 | ||
| CHEMBL4449712 | 2680 | None | 22 | Human | Binding | pEC50 | = | 6.3 | 6.3 | -3 | 3 | Agonist activity at human MT2 receptor expressed in HTLA cells assessed as stimulation of beta-arrestin recruitment incubated for 16 to 20 hrs by bright-glo luminescence assayAgonist activity at human MT2 receptor expressed in HTLA cells assessed as stimulation of beta-arrestin recruitment incubated for 16 to 20 hrs by bright-glo luminescence assay |
ChEMBL | 417 | 7 | 3 | 7 | 4.2 | OCc1cccc(c1c1nc(NCc2ccc(cc2)Oc2ccccc2)nc(n1)N)F | 10.1021/acs.jmedchem.9b00869 | ||
| 23634404 | 125917 | None | 0 | Human | Binding | pIC50 | = | 10.3 | 10.3 | - | 0 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 272 | 4 | 1 | 3 | 3.1 | CCC(=O)NCC[C@@H]1CCc2ccc3nc(C)oc3c21 | nan | ||
| CHEMBL3648359 | 125917 | None | 0 | Human | Binding | pIC50 | = | 10.3 | 10.3 | - | 0 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 272 | 4 | 1 | 3 | 3.1 | CCC(=O)NCC[C@@H]1CCc2ccc3nc(C)oc3c21 | nan | ||
| 57781211 | 125919 | None | 0 | Human | Binding | pIC50 | = | 10.0 | 10.0 | - | 0 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 376 | 8 | 1 | 3 | 4.9 | CC(=O)NCCC1CCc2ccc3nc(CCCCc4ccccc4)oc3c21 | nan | ||
| CHEMBL3648361 | 125919 | None | 0 | Human | Binding | pIC50 | = | 10.0 | 10.0 | - | 0 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 376 | 8 | 1 | 3 | 4.9 | CC(=O)NCCC1CCc2ccc3nc(CCCCc4ccccc4)oc3c21 | nan | ||
| 23725569 | 125921 | None | 0 | Human | Binding | pIC50 | = | 9.9 | 9.9 | - | 0 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 274 | 3 | 1 | 3 | 3.2 | CC(=O)NCC[C@@H]1CCc2ccc3nc(C)sc3c21 | nan | ||
| CHEMBL3648363 | 125921 | None | 0 | Human | Binding | pIC50 | = | 9.9 | 9.9 | - | 0 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 274 | 3 | 1 | 3 | 3.2 | CC(=O)NCC[C@@H]1CCc2ccc3nc(C)sc3c21 | nan | ||
| 57781216 | 125914 | None | 1 | Human | Binding | pIC50 | = | 9.9 | 9.9 | -2 | 2 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 258 | 3 | 1 | 3 | 2.7 | CC(=O)NCC[C@@H]1CCc2ccc3nc(C)oc3c21 | nan | ||
| CHEMBL3648356 | 125914 | None | 1 | Human | Binding | pIC50 | = | 9.9 | 9.9 | -2 | 2 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 258 | 3 | 1 | 3 | 2.7 | CC(=O)NCC[C@@H]1CCc2ccc3nc(C)oc3c21 | nan | ||
| 57781258 | 125927 | None | 0 | Human | Binding | pIC50 | = | 9.9 | 9.9 | - | 0 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 312 | 3 | 1 | 3 | 3.2 | Cc1nc2ccc3c(c2o1)C(CCNC(=O)C(F)(F)F)CC3 | nan | ||
| CHEMBL3648369 | 125927 | None | 0 | Human | Binding | pIC50 | = | 9.9 | 9.9 | - | 0 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 312 | 3 | 1 | 3 | 3.2 | Cc1nc2ccc3c(c2o1)C(CCNC(=O)C(F)(F)F)CC3 | nan | ||
| 57781244 | 160927 | None | 0 | Human | Binding | pIC50 | = | 9.7 | 9.7 | - | 0 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 270 | 3 | 1 | 3 | 3.0 | CCC(=O)NC/C=C1\CCc2ccc3nc(C)oc3c21 | nan | ||
| CHEMBL4114700 | 160927 | None | 0 | Human | Binding | pIC50 | = | 9.7 | 9.7 | - | 0 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 270 | 3 | 1 | 3 | 3.0 | CCC(=O)NC/C=C1\CCc2ccc3nc(C)oc3c21 | nan | ||
| 57781280 | 161058 | None | 0 | Human | Binding | pIC50 | = | 9.7 | 9.7 | - | 0 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 272 | 2 | 1 | 3 | 3.1 | CC(=O)NC/C=C1\CCc2ccc3nc(C)sc3c21 | nan | ||
| CHEMBL4115681 | 161058 | None | 0 | Human | Binding | pIC50 | = | 9.7 | 9.7 | - | 0 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 272 | 2 | 1 | 3 | 3.1 | CC(=O)NC/C=C1\CCc2ccc3nc(C)sc3c21 | nan | ||
| 23725512 | 125911 | None | 0 | Human | Binding | pIC50 | = | 9.6 | 9.6 | - | 0 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 256 | 3 | 1 | 3 | 2.6 | CC(=O)NCCC1=CCc2ccc3nc(C)oc3c21 | nan | ||
| CHEMBL3648350 | 125911 | None | 0 | Human | Binding | pIC50 | = | 9.6 | 9.6 | - | 0 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 256 | 3 | 1 | 3 | 2.6 | CC(=O)NCCC1=CCc2ccc3nc(C)oc3c21 | nan | ||
| 23725514 | 125916 | None | 0 | Human | Binding | pIC50 | = | 9.6 | 9.6 | -1 | 2 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 272 | 4 | 1 | 3 | 3.1 | CCC(=O)NCCC1CCc2ccc3nc(C)oc3c21 | nan | ||
| CHEMBL3648358 | 125916 | None | 0 | Human | Binding | pIC50 | = | 9.6 | 9.6 | -1 | 2 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 272 | 4 | 1 | 3 | 3.1 | CCC(=O)NCCC1CCc2ccc3nc(C)oc3c21 | nan | ||
| 23725567 | 125920 | None | 0 | Human | Binding | pIC50 | = | 9.6 | 9.6 | -2 | 2 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 274 | 3 | 1 | 3 | 3.2 | CC(=O)NCCC1CCc2ccc3nc(C)sc3c21 | nan | ||
| CHEMBL3648362 | 125920 | None | 0 | Human | Binding | pIC50 | = | 9.6 | 9.6 | -2 | 2 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 274 | 3 | 1 | 3 | 3.2 | CC(=O)NCCC1CCc2ccc3nc(C)sc3c21 | nan | ||
| 23725612 | 125925 | None | 0 | Human | Binding | pIC50 | = | 9.6 | 9.6 | 2 | 2 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 274 | 4 | 1 | 4 | 2.4 | COc1nc2ccc3c(c2o1)C(CCNC(C)=O)CC3 | nan | ||
| CHEMBL3648367 | 125925 | None | 0 | Human | Binding | pIC50 | = | 9.6 | 9.6 | 2 | 2 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 274 | 4 | 1 | 4 | 2.4 | COc1nc2ccc3c(c2o1)C(CCNC(C)=O)CC3 | nan | ||
| 1357 | 2485 | None | 75 | Human | Binding | pIC50 | = | 9.5 | 9.5 | 1 | 8 | In vitro receptor binding at MT2 (Melatonin) receptor.In vitro receptor binding at MT2 (Melatonin) receptor. |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1016/s0960-894x(03)00090-8 | ||
| 1672 | 2485 | None | 75 | Human | Binding | pIC50 | = | 9.5 | 9.5 | 1 | 8 | In vitro receptor binding at MT2 (Melatonin) receptor.In vitro receptor binding at MT2 (Melatonin) receptor. |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1016/s0960-894x(03)00090-8 | ||
| 224 | 2485 | None | 75 | Human | Binding | pIC50 | = | 9.5 | 9.5 | 1 | 8 | In vitro receptor binding at MT2 (Melatonin) receptor.In vitro receptor binding at MT2 (Melatonin) receptor. |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1016/s0960-894x(03)00090-8 | ||
| 896 | 2485 | None | 75 | Human | Binding | pIC50 | = | 9.5 | 9.5 | 1 | 8 | In vitro receptor binding at MT2 (Melatonin) receptor.In vitro receptor binding at MT2 (Melatonin) receptor. |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1016/s0960-894x(03)00090-8 | ||
| CHEMBL45 | 2485 | None | 75 | Human | Binding | pIC50 | = | 9.5 | 9.5 | 1 | 8 | In vitro receptor binding at MT2 (Melatonin) receptor.In vitro receptor binding at MT2 (Melatonin) receptor. |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1016/s0960-894x(03)00090-8 | ||
| DB01065 | 2485 | None | 75 | Human | Binding | pIC50 | = | 9.5 | 9.5 | 1 | 8 | In vitro receptor binding at MT2 (Melatonin) receptor.In vitro receptor binding at MT2 (Melatonin) receptor. |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1016/s0960-894x(03)00090-8 | ||
| 57781227 | 125912 | None | 0 | Human | Binding | pIC50 | = | 9.5 | 9.5 | 6 | 2 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 244 | 3 | 1 | 3 | 2.4 | CC(=O)NCCC1CCc2ccc3ncoc3c21 | nan | ||
| CHEMBL3648354 | 125912 | None | 0 | Human | Binding | pIC50 | = | 9.5 | 9.5 | 6 | 2 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 244 | 3 | 1 | 3 | 2.4 | CC(=O)NCCC1CCc2ccc3ncoc3c21 | nan | ||
| 23725565 | 125913 | None | 0 | Human | Binding | pIC50 | = | 9.5 | 9.5 | -1 | 2 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 258 | 3 | 1 | 3 | 2.7 | CC(=O)NCCC1CCc2ccc3nc(C)oc3c21 | nan | ||
| CHEMBL3648355 | 125913 | None | 0 | Human | Binding | pIC50 | = | 9.5 | 9.5 | -1 | 2 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 258 | 3 | 1 | 3 | 2.7 | CC(=O)NCCC1CCc2ccc3nc(C)oc3c21 | nan | ||
| 57781268 | 160924 | None | 0 | Human | Binding | pIC50 | = | 9.4 | 9.4 | - | 0 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 256 | 2 | 1 | 3 | 2.6 | CC(=O)NC/C=C1\CCc2ccc3nc(C)oc3c21 | nan | ||
| CHEMBL4114658 | 160924 | None | 0 | Human | Binding | pIC50 | = | 9.4 | 9.4 | - | 0 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 256 | 2 | 1 | 3 | 2.6 | CC(=O)NC/C=C1\CCc2ccc3nc(C)oc3c21 | nan | ||
| 23725515 | 125923 | None | 0 | Human | Binding | pIC50 | = | 9.4 | 9.4 | 1 | 2 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 272 | 4 | 1 | 3 | 2.9 | CCc1nc2ccc3c(c2o1)C(CCNC(C)=O)CC3 | nan | ||
| CHEMBL3648365 | 125923 | None | 0 | Human | Binding | pIC50 | = | 9.4 | 9.4 | 1 | 2 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 272 | 4 | 1 | 3 | 2.9 | CCc1nc2ccc3c(c2o1)C(CCNC(C)=O)CC3 | nan | ||
| 57781262 | 160930 | None | 0 | Human | Binding | pIC50 | = | 9.4 | 9.4 | - | 0 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 374 | 7 | 1 | 3 | 4.9 | CC(=O)NC/C=C1\CCc2ccc3nc(CCCCc4ccccc4)oc3c21 | nan | ||
| CHEMBL4114715 | 160930 | None | 0 | Human | Binding | pIC50 | = | 9.4 | 9.4 | - | 0 | Binding Assay: Binding assay using melatonin receptors 1 or 2.Binding Assay: Binding assay using melatonin receptors 1 or 2. |
ChEMBL | 374 | 7 | 1 | 3 | 4.9 | CC(=O)NC/C=C1\CCc2ccc3nc(CCCCc4ccccc4)oc3c21 | nan | ||
| 1357 | 2485 | None | 75 | Human | Binding | pIC50 | = | 9.3 | 9.3 | 1 | 8 | Binding affinity to human MT2 receptorBinding affinity to human MT2 receptor |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1016/j.ejmech.2011.02.010 | ||
| 1672 | 2485 | None | 75 | Human | Binding | pIC50 | = | 9.3 | 9.3 | 1 | 8 | Binding affinity to human MT2 receptorBinding affinity to human MT2 receptor |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1016/j.ejmech.2011.02.010 | ||
| 224 | 2485 | None | 75 | Human | Binding | pIC50 | = | 9.3 | 9.3 | 1 | 8 | Binding affinity to human MT2 receptorBinding affinity to human MT2 receptor |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1016/j.ejmech.2011.02.010 | ||
| 896 | 2485 | None | 75 | Human | Binding | pIC50 | = | 9.3 | 9.3 | 1 | 8 | Binding affinity to human MT2 receptorBinding affinity to human MT2 receptor |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1016/j.ejmech.2011.02.010 | ||
| CHEMBL45 | 2485 | None | 75 | Human | Binding | pIC50 | = | 9.3 | 9.3 | 1 | 8 | Binding affinity to human MT2 receptorBinding affinity to human MT2 receptor |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1016/j.ejmech.2011.02.010 | ||
| DB01065 | 2485 | None | 75 | Human | Binding | pIC50 | = | 9.3 | 9.3 | 1 | 8 | Binding affinity to human MT2 receptorBinding affinity to human MT2 receptor |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1016/j.ejmech.2011.02.010 | ||
| 1357 | 2485 | None | 75 | Human | Binding | pIC50 | = | 9.3 | 9.3 | 1 | 8 | Displacement of 2-[125I]iodomelatonin from human MT2 receptor expressed in HEK293 cellsDisplacement of 2-[125I]iodomelatonin from human MT2 receptor expressed in HEK293 cells |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1016/j.bmc.2008.03.036 | ||
| 1672 | 2485 | None | 75 | Human | Binding | pIC50 | = | 9.3 | 9.3 | 1 | 8 | Displacement of 2-[125I]iodomelatonin from human MT2 receptor expressed in HEK293 cellsDisplacement of 2-[125I]iodomelatonin from human MT2 receptor expressed in HEK293 cells |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1016/j.bmc.2008.03.036 | ||
| 224 | 2485 | None | 75 | Human | Binding | pIC50 | = | 9.3 | 9.3 | 1 | 8 | Displacement of 2-[125I]iodomelatonin from human MT2 receptor expressed in HEK293 cellsDisplacement of 2-[125I]iodomelatonin from human MT2 receptor expressed in HEK293 cells |
ChEMBL | 232 | 4 | 2 | 2 | 1.9 | COc1ccc2c(c1)c(CCNC(=O)C)c[nH]2 | 10.1016/j.bmc.2008.03.036 | ||
Showing 1 to 50 of 3,157 entries